C7H9ClN4O2S — CID 175802168
1-(aminomethyl)-5-(1,3-thiazol-4-yl)imidazolidine-2,4-dione;hydrochloride (PubChem CID 175802168) has the molecular formula C7H9ClN4O2S and a molecular weight of 248.69 g/mol. Its IUPAC name is 1-(aminomethyl)-5-(1,3-thiazol-4-yl)imidazolidine-2,4-dione;hydrochloride.
| Compound Name | 1-(aminomethyl)-5-(1,3-thiazol-4-yl)imidazolidine-2,4-dione;hydrochloride |
|---|---|
| PubChem CID | 175802168 |
| Molecular Formula | C7H9ClN4O2S |
| Molecular Weight | 248.69 g/mol |
| Exact Mass | 248.01 |
| IUPAC Name | 1-(aminomethyl)-5-(1,3-thiazol-4-yl)imidazolidine-2,4-dione;hydrochloride |
| SMILES | Cl.NCN1C(=O)NC(=O)C1c1cscn1 |
| InChI | InChI=1S/C7H8N4O2S.ClH/c8-2-11-5(4-1-14-3-9-4)6(12)10-7(11)13;/h1,3,5H,2,8H2,(H,10,12,13);1H |
| InChIKey | HXYAUDINMVHPKT-UHFFFAOYSA-N |
| XLogP | 0.07 |
| TPSA | 88.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.69 |
| LogP ≤ 5 | 0.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|