About 3-(5-ethyl-1H-1,2,4-triazol-3-yl)-4-fluoro-2-methylbenzoic acid
3-(5-ethyl-1H-1,2,4-triazol-3-yl)-4-fluoro-2-methylbenzoic acid (PubChem CID 175802486) has the molecular formula C12H12FN3O2
and a molecular weight of 249.24 g/mol. Its IUPAC name is 3-(5-ethyl-1H-1,2,4-triazol-3-yl)-4-fluoro-2-methylbenzoic acid.
Molecular Properties
| Compound Name | 3-(5-ethyl-1H-1,2,4-triazol-3-yl)-4-fluoro-2-methylbenzoic acid |
| PubChem CID | 175802486 |
| Molecular Formula | C12H12FN3O2 |
| Molecular Weight | 249.24 g/mol |
| Exact Mass | 249.09 |
| IUPAC Name | 3-(5-ethyl-1H-1,2,4-triazol-3-yl)-4-fluoro-2-methylbenzoic acid |
| SMILES | CCc1nc(-c2c(F)ccc(C(=O)O)c2C)n[nH]1 |
| InChI | InChI=1S/C12H12FN3O2/c1-3-9-14-11(16-15-9)10-6(2)7(12(17)18)4-5-8(10)13/h4-5H,3H2,1-2H3,(H,17,18)(H,14,15,16) |
| InChIKey | QBTNTVBRYGMIDD-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 78.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 249.24 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-(5-ethyl-1H-1,2,4-triazol-3-yl)-4-fluoro-2-methylbenzoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(5-ethyl-1H-1,2,4-triazol-3-yl)-4-fluoro-2-methylbenzoic acid?
The IUPAC name of 3-(5-ethyl-1H-1,2,4-triazol-3-yl)-4-fluoro-2-methylbenzoic acid (CID 175802486) is 3-(5-ethyl-1H-1,2,4-triazol-3-yl)-4-fluoro-2-methylbenzoic acid.
What is the SMILES notation for 3-(5-ethyl-1H-1,2,4-triazol-3-yl)-4-fluoro-2-methylbenzoic acid?
The canonical SMILES for 3-(5-ethyl-1H-1,2,4-triazol-3-yl)-4-fluoro-2-methylbenzoic acid is CCc1nc(-c2c(F)ccc(C(=O)O)c2C)n[nH]1.
What is the InChIKey of 3-(5-ethyl-1H-1,2,4-triazol-3-yl)-4-fluoro-2-methylbenzoic acid?
The InChIKey is QBTNTVBRYGMIDD-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H12FN3O2/c1-3-9-14-11(16-15-9)10-6(2)7(12(17)18)4-5-8(10)13/h4-5H,3H2,1-2H3,(H,17,18)(H,14,15,16).
What are the key properties of 3-(5-ethyl-1H-1,2,4-triazol-3-yl)-4-fluoro-2-methylbenzoic acid?
3-(5-ethyl-1H-1,2,4-triazol-3-yl)-4-fluoro-2-methylbenzoic acid has a molecular weight of 249.24 g/mol, XLogP of 2.18, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(5-ethyl-1H-1,2,4-triazol-3-yl)-4-fluoro-2-methylbenzoic acid is sourced from PubChem (CID 175802486), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).