C10H17N — CID 175802551
5-methyl-1,2,3,4,4a,5,6,7-octahydroisoquinoline (PubChem CID 175802551) has the molecular formula C10H17N and a molecular weight of 151.25 g/mol. Its IUPAC name is 5-methyl-1,2,3,4,4a,5,6,7-octahydroisoquinoline.
| Compound Name | 5-methyl-1,2,3,4,4a,5,6,7-octahydroisoquinoline |
|---|---|
| PubChem CID | 175802551 |
| Molecular Formula | C10H17N |
| Molecular Weight | 151.25 g/mol |
| Exact Mass | 151.14 |
| IUPAC Name | 5-methyl-1,2,3,4,4a,5,6,7-octahydroisoquinoline |
| SMILES | CC1CCC=C2CNCCC21 |
| InChI | InChI=1S/C10H17N/c1-8-3-2-4-9-7-11-6-5-10(8)9/h4,8,10-11H,2-3,5-7H2,1H3 |
| InChIKey | WRKREABJAALMOV-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 151.25 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|