About 2-(difluoroamino)-3,4,5-trifluorobenzenethiol
2-(difluoroamino)-3,4,5-trifluorobenzenethiol (PubChem CID 175802909) has the molecular formula C6H2F5NS
and a molecular weight of 215.15 g/mol. Its IUPAC name is 2-(difluoroamino)-3,4,5-trifluorobenzenethiol.
Molecular Properties
| Compound Name | 2-(difluoroamino)-3,4,5-trifluorobenzenethiol |
| PubChem CID | 175802909 |
| Molecular Formula | C6H2F5NS |
| Molecular Weight | 215.15 g/mol |
| Exact Mass | 214.98 |
| IUPAC Name | 2-(difluoroamino)-3,4,5-trifluorobenzenethiol |
| SMILES | Fc1cc(S)c(N(F)F)c(F)c1F |
| InChI | InChI=1S/C6H2F5NS/c7-2-1-3(13)6(12(10)11)5(9)4(2)8/h1,13H |
| InChIKey | OEINADXSIBKSOW-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 3.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 215.15 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze 2-(difluoroamino)-3,4,5-trifluorobenzenethiol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(difluoroamino)-3,4,5-trifluorobenzenethiol?
The IUPAC name of 2-(difluoroamino)-3,4,5-trifluorobenzenethiol (CID 175802909) is 2-(difluoroamino)-3,4,5-trifluorobenzenethiol.
What is the SMILES notation for 2-(difluoroamino)-3,4,5-trifluorobenzenethiol?
The canonical SMILES for 2-(difluoroamino)-3,4,5-trifluorobenzenethiol is Fc1cc(S)c(N(F)F)c(F)c1F.
What is the InChIKey of 2-(difluoroamino)-3,4,5-trifluorobenzenethiol?
The InChIKey is OEINADXSIBKSOW-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H2F5NS/c7-2-1-3(13)6(12(10)11)5(9)4(2)8/h1,13H.
What are the key properties of 2-(difluoroamino)-3,4,5-trifluorobenzenethiol?
2-(difluoroamino)-3,4,5-trifluorobenzenethiol has a molecular weight of 215.15 g/mol, XLogP of 2.97, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(difluoroamino)-3,4,5-trifluorobenzenethiol is sourced from PubChem (CID 175802909), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).