About (Z)-2-(4-chloro-2-methoxyphenoxy)but-2-enedioic acid;(E)-2-(4-chloro-2-methoxyphenoxy)but-2-enedioic acid
(Z)-2-(4-chloro-2-methoxyphenoxy)but-2-enedioic acid;(E)-2-(4-chloro-2-methoxyphenoxy)but-2-enedioic acid (PubChem CID 175803273) has the molecular formula C22H18Cl2O12
and a molecular weight of 545.28 g/mol. Its IUPAC name is (Z)-2-(4-chloro-2-methoxyphenoxy)but-2-enedioic acid;(E)-2-(4-chloro-2-methoxyphenoxy)but-2-enedioic acid.
Molecular Properties
| Compound Name | (Z)-2-(4-chloro-2-methoxyphenoxy)but-2-enedioic acid;(E)-2-(4-chloro-2-methoxyphenoxy)but-2-enedioic acid |
| PubChem CID | 175803273 |
| Molecular Formula | C22H18Cl2O12 |
| Molecular Weight | 545.28 g/mol |
| Exact Mass | 544.02 |
| IUPAC Name | (Z)-2-(4-chloro-2-methoxyphenoxy)but-2-enedioic acid;(E)-2-(4-chloro-2-methoxyphenoxy)but-2-enedioic acid |
| SMILES | COc1cc(Cl)ccc1O/C(=C/C(=O)O)C(=O)O.COc1cc(Cl)ccc1O/C(=C\C(=O)O)C(=O)O |
| InChI | InChI=1S/2C11H9ClO6/c2*1-17-8-4-6(12)2-3-7(8)18-9(11(15)16)5-10(13)14/h2*2-5H,1H3,(H,13,14)(H,15,16)/b9-5+;9-5- |
| InChIKey | QOLCBQVEXPKXDB-YEYRGWEPSA-N |
| XLogP | 3.56 |
| TPSA | 186.12 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 545.28 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (Z)-2-(4-chloro-2-methoxyphenoxy)but-2-enedioic acid;(E)-2-(4-chloro-2-methoxyphenoxy)but-2-enedioic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z)-2-(4-chloro-2-methoxyphenoxy)but-2-enedioic acid;(E)-2-(4-chloro-2-methoxyphenoxy)but-2-enedioic acid?
The IUPAC name of (Z)-2-(4-chloro-2-methoxyphenoxy)but-2-enedioic acid;(E)-2-(4-chloro-2-methoxyphenoxy)but-2-enedioic acid (CID 175803273) is (Z)-2-(4-chloro-2-methoxyphenoxy)but-2-enedioic acid;(E)-2-(4-chloro-2-methoxyphenoxy)but-2-enedioic acid.
What is the SMILES notation for (Z)-2-(4-chloro-2-methoxyphenoxy)but-2-enedioic acid;(E)-2-(4-chloro-2-methoxyphenoxy)but-2-enedioic acid?
The canonical SMILES for (Z)-2-(4-chloro-2-methoxyphenoxy)but-2-enedioic acid;(E)-2-(4-chloro-2-methoxyphenoxy)but-2-enedioic acid is COc1cc(Cl)ccc1O/C(=C/C(=O)O)C(=O)O.COc1cc(Cl)ccc1O/C(=C\C(=O)O)C(=O)O.
What is the InChIKey of (Z)-2-(4-chloro-2-methoxyphenoxy)but-2-enedioic acid;(E)-2-(4-chloro-2-methoxyphenoxy)but-2-enedioic acid?
The InChIKey is QOLCBQVEXPKXDB-YEYRGWEPSA-N. The full InChI is InChI=1S/2C11H9ClO6/c2*1-17-8-4-6(12)2-3-7(8)18-9(11(15)16)5-10(13)14/h2*2-5H,1H3,(H,13,14)(H,15,16)/b9-5+;9-5-.
What are the key properties of (Z)-2-(4-chloro-2-methoxyphenoxy)but-2-enedioic acid;(E)-2-(4-chloro-2-methoxyphenoxy)but-2-enedioic acid?
(Z)-2-(4-chloro-2-methoxyphenoxy)but-2-enedioic acid;(E)-2-(4-chloro-2-methoxyphenoxy)but-2-enedioic acid has a molecular weight of 545.28 g/mol, XLogP of 3.56, 10 rotatable bonds, 4 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-2-(4-chloro-2-methoxyphenoxy)but-2-enedioic acid;(E)-2-(4-chloro-2-methoxyphenoxy)but-2-enedioic acid is sourced from PubChem (CID 175803273), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).