About bis(1-(2-tert-butylphenyl)thieno[2,3-h]isoquinoline);iridium(3+)
bis(1-(2-tert-butylphenyl)thieno[2,3-h]isoquinoline);iridium(3+) (PubChem CID 175803562) has the molecular formula C42H38IrN2S2+3
and a molecular weight of 827.13 g/mol. Its IUPAC name is bis(1-(2-tert-butylphenyl)thieno[2,3-h]isoquinoline);iridium(3+).
Molecular Properties
| Compound Name | bis(1-(2-tert-butylphenyl)thieno[2,3-h]isoquinoline);iridium(3+) |
| PubChem CID | 175803562 |
| Molecular Formula | C42H38IrN2S2+3 |
| Molecular Weight | 827.13 g/mol |
| Exact Mass | 827.21 |
| IUPAC Name | bis(1-(2-tert-butylphenyl)thieno[2,3-h]isoquinoline);iridium(3+) |
| SMILES | CC(C)(C)c1ccccc1-c1nccc2ccc3sccc3c12.CC(C)(C)c1ccccc1-c1nccc2ccc3sccc3c12.[Ir+3] |
| InChI | InChI=1S/2C21H19NS.Ir/c2*1-21(2,3)17-7-5-4-6-15(17)20-19-14(10-12-22-20)8-9-18-16(19)11-13-23-18;/h2*4-13H,1-3H3;/q;;+3 |
| InChIKey | GDGIOBMQAZDVLB-UHFFFAOYSA-N |
| XLogP | 12.83 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 47 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 827.13 |
| LogP ≤ 5 | 12.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze bis(1-(2-tert-butylphenyl)thieno[2,3-h]isoquinoline);iridium(3+) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(1-(2-tert-butylphenyl)thieno[2,3-h]isoquinoline);iridium(3+)?
The IUPAC name of bis(1-(2-tert-butylphenyl)thieno[2,3-h]isoquinoline);iridium(3+) (CID 175803562) is bis(1-(2-tert-butylphenyl)thieno[2,3-h]isoquinoline);iridium(3+).
What is the SMILES notation for bis(1-(2-tert-butylphenyl)thieno[2,3-h]isoquinoline);iridium(3+)?
The canonical SMILES for bis(1-(2-tert-butylphenyl)thieno[2,3-h]isoquinoline);iridium(3+) is CC(C)(C)c1ccccc1-c1nccc2ccc3sccc3c12.CC(C)(C)c1ccccc1-c1nccc2ccc3sccc3c12.[Ir+3].
What is the InChIKey of bis(1-(2-tert-butylphenyl)thieno[2,3-h]isoquinoline);iridium(3+)?
The InChIKey is GDGIOBMQAZDVLB-UHFFFAOYSA-N. The full InChI is InChI=1S/2C21H19NS.Ir/c2*1-21(2,3)17-7-5-4-6-15(17)20-19-14(10-12-22-20)8-9-18-16(19)11-13-23-18;/h2*4-13H,1-3H3;/q;;+3.
What are the key properties of bis(1-(2-tert-butylphenyl)thieno[2,3-h]isoquinoline);iridium(3+)?
bis(1-(2-tert-butylphenyl)thieno[2,3-h]isoquinoline);iridium(3+) has a molecular weight of 827.13 g/mol, XLogP of 12.83, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for bis(1-(2-tert-butylphenyl)thieno[2,3-h]isoquinoline);iridium(3+) is sourced from PubChem (CID 175803562), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).