C12H15ClF3N3O2 — CID 175804200
1-(6-chloro-3-pyridinyl)piperidin-3-amine;2,2,2-trifluoroacetic acid (PubChem CID 175804200) has the molecular formula C12H15ClF3N3O2 and a molecular weight of 325.72 g/mol. Its IUPAC name is 1-(6-chloro-3-pyridinyl)piperidin-3-amine;2,2,2-trifluoroacetic acid.
| Compound Name | 1-(6-chloro-3-pyridinyl)piperidin-3-amine;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 175804200 |
| Molecular Formula | C12H15ClF3N3O2 |
| Molecular Weight | 325.72 g/mol |
| Exact Mass | 325.08 |
| IUPAC Name | 1-(6-chloro-3-pyridinyl)piperidin-3-amine;2,2,2-trifluoroacetic acid |
| SMILES | NC1CCCN(c2ccc(Cl)nc2)C1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C10H14ClN3.C2HF3O2/c11-10-4-3-9(6-13-10)14-5-1-2-8(12)7-14;3-2(4,5)1(6)7/h3-4,6,8H,1-2,5,7,12H2;(H,6,7) |
| InChIKey | XUGXWLZSCWBAMA-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 79.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.72 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|