About benzenesulfonic acid;N,N-bis(methylamino)-2-methylidenepentanamide
benzenesulfonic acid;N,N-bis(methylamino)-2-methylidenepentanamide (PubChem CID 175804864) has the molecular formula C14H23N3O4S
and a molecular weight of 329.42 g/mol. Its IUPAC name is benzenesulfonic acid;N,N-bis(methylamino)-2-methylidenepentanamide.
Molecular Properties
| Compound Name | benzenesulfonic acid;N,N-bis(methylamino)-2-methylidenepentanamide |
| PubChem CID | 175804864 |
| Molecular Formula | C14H23N3O4S |
| Molecular Weight | 329.42 g/mol |
| Exact Mass | 329.14 |
| IUPAC Name | benzenesulfonic acid;N,N-bis(methylamino)-2-methylidenepentanamide |
| SMILES | C=C(CCC)C(=O)N(NC)NC.O=S(=O)(O)c1ccccc1 |
| InChI | InChI=1S/C8H17N3O.C6H6O3S/c1-5-6-7(2)8(12)11(9-3)10-4;7-10(8,9)6-4-2-1-3-5-6/h9-10H,2,5-6H2,1,3-4H3;1-5H,(H,7,8,9) |
| InChIKey | CNLAZSBJJNQMCP-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 98.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 329.42 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze benzenesulfonic acid;N,N-bis(methylamino)-2-methylidenepentanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzenesulfonic acid;N,N-bis(methylamino)-2-methylidenepentanamide?
The IUPAC name of benzenesulfonic acid;N,N-bis(methylamino)-2-methylidenepentanamide (CID 175804864) is benzenesulfonic acid;N,N-bis(methylamino)-2-methylidenepentanamide.
What is the SMILES notation for benzenesulfonic acid;N,N-bis(methylamino)-2-methylidenepentanamide?
The canonical SMILES for benzenesulfonic acid;N,N-bis(methylamino)-2-methylidenepentanamide is C=C(CCC)C(=O)N(NC)NC.O=S(=O)(O)c1ccccc1.
What is the InChIKey of benzenesulfonic acid;N,N-bis(methylamino)-2-methylidenepentanamide?
The InChIKey is CNLAZSBJJNQMCP-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H17N3O.C6H6O3S/c1-5-6-7(2)8(12)11(9-3)10-4;7-10(8,9)6-4-2-1-3-5-6/h9-10H,2,5-6H2,1,3-4H3;1-5H,(H,7,8,9).
What are the key properties of benzenesulfonic acid;N,N-bis(methylamino)-2-methylidenepentanamide?
benzenesulfonic acid;N,N-bis(methylamino)-2-methylidenepentanamide has a molecular weight of 329.42 g/mol, XLogP of 1.37, 6 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for benzenesulfonic acid;N,N-bis(methylamino)-2-methylidenepentanamide is sourced from PubChem (CID 175804864), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).