About 6H-pyrrolo[3,4-d]pyrimidine-4-carbonitrile
6H-pyrrolo[3,4-d]pyrimidine-4-carbonitrile (PubChem CID 175804931) has the molecular formula C7H4N4
and a molecular weight of 144.14 g/mol. Its IUPAC name is 6H-pyrrolo[3,4-d]pyrimidine-4-carbonitrile.
Molecular Properties
| Compound Name | 6H-pyrrolo[3,4-d]pyrimidine-4-carbonitrile |
| PubChem CID | 175804931 |
| Molecular Formula | C7H4N4 |
| Molecular Weight | 144.14 g/mol |
| Exact Mass | 144.04 |
| IUPAC Name | 6H-pyrrolo[3,4-d]pyrimidine-4-carbonitrile |
| SMILES | N#Cc1ncnc2c[nH]cc12 |
| InChI | InChI=1S/C7H4N4/c8-1-6-5-2-9-3-7(5)11-4-10-6/h2-4,9H |
| InChIKey | FHQNPQHEWRLSQG-UHFFFAOYSA-N |
| XLogP | 0.83 |
| TPSA | 65.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 144.14 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 6H-pyrrolo[3,4-d]pyrimidine-4-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6H-pyrrolo[3,4-d]pyrimidine-4-carbonitrile?
The IUPAC name of 6H-pyrrolo[3,4-d]pyrimidine-4-carbonitrile (CID 175804931) is 6H-pyrrolo[3,4-d]pyrimidine-4-carbonitrile.
What is the SMILES notation for 6H-pyrrolo[3,4-d]pyrimidine-4-carbonitrile?
The canonical SMILES for 6H-pyrrolo[3,4-d]pyrimidine-4-carbonitrile is N#Cc1ncnc2c[nH]cc12.
What is the InChIKey of 6H-pyrrolo[3,4-d]pyrimidine-4-carbonitrile?
The InChIKey is FHQNPQHEWRLSQG-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H4N4/c8-1-6-5-2-9-3-7(5)11-4-10-6/h2-4,9H.
What are the key properties of 6H-pyrrolo[3,4-d]pyrimidine-4-carbonitrile?
6H-pyrrolo[3,4-d]pyrimidine-4-carbonitrile has a molecular weight of 144.14 g/mol, XLogP of 0.83, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6H-pyrrolo[3,4-d]pyrimidine-4-carbonitrile is sourced from PubChem (CID 175804931), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).