About butyl 4-[2-(3-methyl-1,2-oxazol-5-yl)acetyl]piperidine-1-carboxylate
butyl 4-[2-(3-methyl-1,2-oxazol-5-yl)acetyl]piperidine-1-carboxylate (PubChem CID 175805510) has the molecular formula C16H24N2O4
and a molecular weight of 308.38 g/mol. Its IUPAC name is butyl 4-[2-(3-methyl-1,2-oxazol-5-yl)acetyl]piperidine-1-carboxylate.
Molecular Properties
| Compound Name | butyl 4-[2-(3-methyl-1,2-oxazol-5-yl)acetyl]piperidine-1-carboxylate |
| PubChem CID | 175805510 |
| Molecular Formula | C16H24N2O4 |
| Molecular Weight | 308.38 g/mol |
| Exact Mass | 308.17 |
| IUPAC Name | butyl 4-[2-(3-methyl-1,2-oxazol-5-yl)acetyl]piperidine-1-carboxylate |
| SMILES | CCCCOC(=O)N1CCC(C(=O)Cc2cc(C)no2)CC1 |
| InChI | InChI=1S/C16H24N2O4/c1-3-4-9-21-16(20)18-7-5-13(6-8-18)15(19)11-14-10-12(2)17-22-14/h10,13H,3-9,11H2,1-2H3 |
| InChIKey | ABIOVSNYGGYILE-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 72.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 308.38 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze butyl 4-[2-(3-methyl-1,2-oxazol-5-yl)acetyl]piperidine-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of butyl 4-[2-(3-methyl-1,2-oxazol-5-yl)acetyl]piperidine-1-carboxylate?
The IUPAC name of butyl 4-[2-(3-methyl-1,2-oxazol-5-yl)acetyl]piperidine-1-carboxylate (CID 175805510) is butyl 4-[2-(3-methyl-1,2-oxazol-5-yl)acetyl]piperidine-1-carboxylate.
What is the SMILES notation for butyl 4-[2-(3-methyl-1,2-oxazol-5-yl)acetyl]piperidine-1-carboxylate?
The canonical SMILES for butyl 4-[2-(3-methyl-1,2-oxazol-5-yl)acetyl]piperidine-1-carboxylate is CCCCOC(=O)N1CCC(C(=O)Cc2cc(C)no2)CC1.
What is the InChIKey of butyl 4-[2-(3-methyl-1,2-oxazol-5-yl)acetyl]piperidine-1-carboxylate?
The InChIKey is ABIOVSNYGGYILE-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H24N2O4/c1-3-4-9-21-16(20)18-7-5-13(6-8-18)15(19)11-14-10-12(2)17-22-14/h10,13H,3-9,11H2,1-2H3.
What are the key properties of butyl 4-[2-(3-methyl-1,2-oxazol-5-yl)acetyl]piperidine-1-carboxylate?
butyl 4-[2-(3-methyl-1,2-oxazol-5-yl)acetyl]piperidine-1-carboxylate has a molecular weight of 308.38 g/mol, XLogP of 2.74, 6 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for butyl 4-[2-(3-methyl-1,2-oxazol-5-yl)acetyl]piperidine-1-carboxylate is sourced from PubChem (CID 175805510), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).