C28H29ClN4O5S — CID 175805543
3-[[7-[6-chloro-1-[(3S,5R)-5-(hydroxymethyl)pyrrolidin-3-yl]-3,4-dihydro-2H-quinolin-8-yl]thieno[3,2-b]pyridin-2-yl]methyl]-3-azabicyclo[3.1.0]hexane-2,4-dione;formic acid (PubChem CID 175805543) has the molecular formula C28H29ClN4O5S and a molecular weight of 569.08 g/mol. Its IUPAC name is 3-[[7-[6-chloro-1-[(3S,5R)-5-(hydroxymethyl)pyrrolidin-3-yl]-3,4-dihydro-2H-quinolin-8-yl]thieno[3,2-b]pyridin-2-yl]methyl]-3-azabicyclo[3.1.0]hexane-2,4-dione;formic acid.
| Compound Name | 3-[[7-[6-chloro-1-[(3S,5R)-5-(hydroxymethyl)pyrrolidin-3-yl]-3,4-dihydro-2H-quinolin-8-yl]thieno[3,2-b]pyridin-2-yl]methyl]-3-azabicyclo[3.1.0]hexane-2,4-dione;formic acid |
|---|---|
| PubChem CID | 175805543 |
| Molecular Formula | C28H29ClN4O5S |
| Molecular Weight | 569.08 g/mol |
| Exact Mass | 568.15 |
| IUPAC Name | 3-[[7-[6-chloro-1-[(3S,5R)-5-(hydroxymethyl)pyrrolidin-3-yl]-3,4-dihydro-2H-quinolin-8-yl]thieno[3,2-b]pyridin-2-yl]methyl]-3-azabicyclo[3.1.0]hexane-2,4-dione;formic acid |
| SMILES | O=C1C2CC2C(=O)N1Cc1cc2nccc(-c3cc(Cl)cc4c3N([C@@H]3CN[C@@H](CO)C3)CCC4)c2s1.O=CO |
| InChI | InChI=1S/C27H27ClN4O3S.CH2O2/c28-15-6-14-2-1-5-31(17-8-16(13-33)30-11-17)24(14)20(7-15)19-3-4-29-23-9-18(36-25(19)23)12-32-26(34)21-10-22(21)27(32)35;2-1-3/h3-4,6-7,9,16-17,21-22,30,33H,1-2,5,8,10-13H2;1H,(H,2,3)/t16-,17+,21?,22?;/m1./s1 |
| InChIKey | RSABPIOSXKCILG-PRADHWLESA-N |
| XLogP | 3.30 |
| TPSA | 123.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.08 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|