About (1R)-1-(4-chloro-2-pyridinyl)-2-methoxy-N,2-dimethylpropan-1-amine
(1R)-1-(4-chloro-2-pyridinyl)-2-methoxy-N,2-dimethylpropan-1-amine (PubChem CID 175806193) has the molecular formula C11H17ClN2O
and a molecular weight of 228.72 g/mol. Its IUPAC name is (1R)-1-(4-chloro-2-pyridinyl)-2-methoxy-N,2-dimethylpropan-1-amine.
Molecular Properties
| Compound Name | (1R)-1-(4-chloro-2-pyridinyl)-2-methoxy-N,2-dimethylpropan-1-amine |
| PubChem CID | 175806193 |
| Molecular Formula | C11H17ClN2O |
| Molecular Weight | 228.72 g/mol |
| Exact Mass | 228.10 |
| IUPAC Name | (1R)-1-(4-chloro-2-pyridinyl)-2-methoxy-N,2-dimethylpropan-1-amine |
| SMILES | CN[C@H](c1cc(Cl)ccn1)C(C)(C)OC |
| InChI | InChI=1S/C11H17ClN2O/c1-11(2,15-4)10(13-3)9-7-8(12)5-6-14-9/h5-7,10,13H,1-4H3/t10-/m1/s1 |
| InChIKey | CTHVZGOCICMALM-SNVBAGLBSA-N |
| XLogP | 2.42 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 228.72 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (1R)-1-(4-chloro-2-pyridinyl)-2-methoxy-N,2-dimethylpropan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1R)-1-(4-chloro-2-pyridinyl)-2-methoxy-N,2-dimethylpropan-1-amine?
The IUPAC name of (1R)-1-(4-chloro-2-pyridinyl)-2-methoxy-N,2-dimethylpropan-1-amine (CID 175806193) is (1R)-1-(4-chloro-2-pyridinyl)-2-methoxy-N,2-dimethylpropan-1-amine.
What is the SMILES notation for (1R)-1-(4-chloro-2-pyridinyl)-2-methoxy-N,2-dimethylpropan-1-amine?
The canonical SMILES for (1R)-1-(4-chloro-2-pyridinyl)-2-methoxy-N,2-dimethylpropan-1-amine is CN[C@H](c1cc(Cl)ccn1)C(C)(C)OC.
What is the InChIKey of (1R)-1-(4-chloro-2-pyridinyl)-2-methoxy-N,2-dimethylpropan-1-amine?
The InChIKey is CTHVZGOCICMALM-SNVBAGLBSA-N. The full InChI is InChI=1S/C11H17ClN2O/c1-11(2,15-4)10(13-3)9-7-8(12)5-6-14-9/h5-7,10,13H,1-4H3/t10-/m1/s1.
What are the key properties of (1R)-1-(4-chloro-2-pyridinyl)-2-methoxy-N,2-dimethylpropan-1-amine?
(1R)-1-(4-chloro-2-pyridinyl)-2-methoxy-N,2-dimethylpropan-1-amine has a molecular weight of 228.72 g/mol, XLogP of 2.42, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (1R)-1-(4-chloro-2-pyridinyl)-2-methoxy-N,2-dimethylpropan-1-amine is sourced from PubChem (CID 175806193), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).