C13H17N5O2S — CID 175807806
N-[1-(7H-pyrrolo[2,3-d]pyrimidin-4-yl)pyrrolidin-3-yl]prop-2-ene-1-sulfonamide (PubChem CID 175807806) has the molecular formula C13H17N5O2S and a molecular weight of 307.38 g/mol. Its IUPAC name is N-[1-(7H-pyrrolo[2,3-d]pyrimidin-4-yl)pyrrolidin-3-yl]prop-2-ene-1-sulfonamide.
| Compound Name | N-[1-(7H-pyrrolo[2,3-d]pyrimidin-4-yl)pyrrolidin-3-yl]prop-2-ene-1-sulfonamide |
|---|---|
| PubChem CID | 175807806 |
| Molecular Formula | C13H17N5O2S |
| Molecular Weight | 307.38 g/mol |
| Exact Mass | 307.11 |
| IUPAC Name | N-[1-(7H-pyrrolo[2,3-d]pyrimidin-4-yl)pyrrolidin-3-yl]prop-2-ene-1-sulfonamide |
| SMILES | C=CCS(=O)(=O)NC1CCN(c2ncnc3[nH]ccc23)C1 |
| InChI | InChI=1S/C13H17N5O2S/c1-2-7-21(19,20)17-10-4-6-18(8-10)13-11-3-5-14-12(11)15-9-16-13/h2-3,5,9-10,17H,1,4,6-8H2,(H,14,15,16) |
| InChIKey | UNNYZYLQHFLABF-UHFFFAOYSA-N |
| XLogP | 0.64 |
| TPSA | 90.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.38 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|