About 9-ethyl-3-ethynyl-6,6-dimethyl-5H-benzo[b]carbazol-11-one
9-ethyl-3-ethynyl-6,6-dimethyl-5H-benzo[b]carbazol-11-one (PubChem CID 175807889) has the molecular formula C22H19NO
and a molecular weight of 313.40 g/mol. Its IUPAC name is 9-ethyl-3-ethynyl-6,6-dimethyl-5H-benzo[b]carbazol-11-one.
Molecular Properties
| Compound Name | 9-ethyl-3-ethynyl-6,6-dimethyl-5H-benzo[b]carbazol-11-one |
| PubChem CID | 175807889 |
| Molecular Formula | C22H19NO |
| Molecular Weight | 313.40 g/mol |
| Exact Mass | 313.15 |
| IUPAC Name | 9-ethyl-3-ethynyl-6,6-dimethyl-5H-benzo[b]carbazol-11-one |
| SMILES | C#Cc1ccc2c3c([nH]c2c1)C(C)(C)c1ccc(CC)cc1C3=O |
| InChI | InChI=1S/C22H19NO/c1-5-13-8-10-17-16(11-13)20(24)19-15-9-7-14(6-2)12-18(15)23-21(19)22(17,3)4/h2,7-12,23H,5H2,1,3-4H3 |
| InChIKey | OGPBIYLASSEMSM-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 32.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 313.40 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 9-ethyl-3-ethynyl-6,6-dimethyl-5H-benzo[b]carbazol-11-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9-ethyl-3-ethynyl-6,6-dimethyl-5H-benzo[b]carbazol-11-one?
The IUPAC name of 9-ethyl-3-ethynyl-6,6-dimethyl-5H-benzo[b]carbazol-11-one (CID 175807889) is 9-ethyl-3-ethynyl-6,6-dimethyl-5H-benzo[b]carbazol-11-one.
What is the SMILES notation for 9-ethyl-3-ethynyl-6,6-dimethyl-5H-benzo[b]carbazol-11-one?
The canonical SMILES for 9-ethyl-3-ethynyl-6,6-dimethyl-5H-benzo[b]carbazol-11-one is C#Cc1ccc2c3c([nH]c2c1)C(C)(C)c1ccc(CC)cc1C3=O.
What is the InChIKey of 9-ethyl-3-ethynyl-6,6-dimethyl-5H-benzo[b]carbazol-11-one?
The InChIKey is OGPBIYLASSEMSM-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H19NO/c1-5-13-8-10-17-16(11-13)20(24)19-15-9-7-14(6-2)12-18(15)23-21(19)22(17,3)4/h2,7-12,23H,5H2,1,3-4H3.
What are the key properties of 9-ethyl-3-ethynyl-6,6-dimethyl-5H-benzo[b]carbazol-11-one?
9-ethyl-3-ethynyl-6,6-dimethyl-5H-benzo[b]carbazol-11-one has a molecular weight of 313.40 g/mol, XLogP of 4.58, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 9-ethyl-3-ethynyl-6,6-dimethyl-5H-benzo[b]carbazol-11-one is sourced from PubChem (CID 175807889), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).