About (3,3-difluorocyclobutyl)-(3,6-dihydro-2H-pyridin-1-yl)methanone
(3,3-difluorocyclobutyl)-(3,6-dihydro-2H-pyridin-1-yl)methanone (PubChem CID 175807923) has the molecular formula C10H13F2NO
and a molecular weight of 201.22 g/mol. Its IUPAC name is (3,3-difluorocyclobutyl)-(3,6-dihydro-2H-pyridin-1-yl)methanone.
Molecular Properties
| Compound Name | (3,3-difluorocyclobutyl)-(3,6-dihydro-2H-pyridin-1-yl)methanone |
| PubChem CID | 175807923 |
| Molecular Formula | C10H13F2NO |
| Molecular Weight | 201.22 g/mol |
| Exact Mass | 201.10 |
| IUPAC Name | (3,3-difluorocyclobutyl)-(3,6-dihydro-2H-pyridin-1-yl)methanone |
| SMILES | O=C(C1CC(F)(F)C1)N1CC=CCC1 |
| InChI | InChI=1S/C10H13F2NO/c11-10(12)6-8(7-10)9(14)13-4-2-1-3-5-13/h1-2,8H,3-7H2 |
| InChIKey | CHJQIOGGXHZWKJ-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 201.22 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (3,3-difluorocyclobutyl)-(3,6-dihydro-2H-pyridin-1-yl)methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3,3-difluorocyclobutyl)-(3,6-dihydro-2H-pyridin-1-yl)methanone?
The IUPAC name of (3,3-difluorocyclobutyl)-(3,6-dihydro-2H-pyridin-1-yl)methanone (CID 175807923) is (3,3-difluorocyclobutyl)-(3,6-dihydro-2H-pyridin-1-yl)methanone.
What is the SMILES notation for (3,3-difluorocyclobutyl)-(3,6-dihydro-2H-pyridin-1-yl)methanone?
The canonical SMILES for (3,3-difluorocyclobutyl)-(3,6-dihydro-2H-pyridin-1-yl)methanone is O=C(C1CC(F)(F)C1)N1CC=CCC1.
What is the InChIKey of (3,3-difluorocyclobutyl)-(3,6-dihydro-2H-pyridin-1-yl)methanone?
The InChIKey is CHJQIOGGXHZWKJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H13F2NO/c11-10(12)6-8(7-10)9(14)13-4-2-1-3-5-13/h1-2,8H,3-7H2.
What are the key properties of (3,3-difluorocyclobutyl)-(3,6-dihydro-2H-pyridin-1-yl)methanone?
(3,3-difluorocyclobutyl)-(3,6-dihydro-2H-pyridin-1-yl)methanone has a molecular weight of 201.22 g/mol, XLogP of 1.82, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (3,3-difluorocyclobutyl)-(3,6-dihydro-2H-pyridin-1-yl)methanone is sourced from PubChem (CID 175807923), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).