C7H5F3N4O2 — CID 175808604
7-(2,2,2-trifluoroethyl)-1,9-dihydropurine-6,8-dione (PubChem CID 175808604) has the molecular formula C7H5F3N4O2 and a molecular weight of 234.14 g/mol. Its IUPAC name is 7-(2,2,2-trifluoroethyl)-1,9-dihydropurine-6,8-dione.
| Compound Name | 7-(2,2,2-trifluoroethyl)-1,9-dihydropurine-6,8-dione |
|---|---|
| PubChem CID | 175808604 |
| Molecular Formula | C7H5F3N4O2 |
| Molecular Weight | 234.14 g/mol |
| Exact Mass | 234.04 |
| IUPAC Name | 7-(2,2,2-trifluoroethyl)-1,9-dihydropurine-6,8-dione |
| SMILES | O=c1[nH]cnc2[nH]c(=O)n(CC(F)(F)F)c12 |
| InChI | InChI=1S/C7H5F3N4O2/c8-7(9,10)1-14-3-4(13-6(14)16)11-2-12-5(3)15/h2H,1H2,(H2,11,12,13,15,16) |
| InChIKey | YKOFBAXIULAHPB-UHFFFAOYSA-N |
| XLogP | -0.02 |
| TPSA | 83.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.14 |
| LogP ≤ 5 | -0.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |