About 7-(3,3,3-trifluoropropyl)-9H-purin-8-one
7-(3,3,3-trifluoropropyl)-9H-purin-8-one (PubChem CID 175808735) has the molecular formula C8H7F3N4O
and a molecular weight of 232.16 g/mol. Its IUPAC name is 7-(3,3,3-trifluoropropyl)-9H-purin-8-one.
Molecular Properties
| Compound Name | 7-(3,3,3-trifluoropropyl)-9H-purin-8-one |
| PubChem CID | 175808735 |
| Molecular Formula | C8H7F3N4O |
| Molecular Weight | 232.16 g/mol |
| Exact Mass | 232.06 |
| IUPAC Name | 7-(3,3,3-trifluoropropyl)-9H-purin-8-one |
| SMILES | O=c1[nH]c2ncncc2n1CCC(F)(F)F |
| InChI | InChI=1S/C8H7F3N4O/c9-8(10,11)1-2-15-5-3-12-4-13-6(5)14-7(15)16/h3-4H,1-2H2,(H,12,13,14,16) |
| InChIKey | ICHNABWLGDNZCT-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 63.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 232.16 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 7-(3,3,3-trifluoropropyl)-9H-purin-8-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-(3,3,3-trifluoropropyl)-9H-purin-8-one?
The IUPAC name of 7-(3,3,3-trifluoropropyl)-9H-purin-8-one (CID 175808735) is 7-(3,3,3-trifluoropropyl)-9H-purin-8-one.
What is the SMILES notation for 7-(3,3,3-trifluoropropyl)-9H-purin-8-one?
The canonical SMILES for 7-(3,3,3-trifluoropropyl)-9H-purin-8-one is O=c1[nH]c2ncncc2n1CCC(F)(F)F.
What is the InChIKey of 7-(3,3,3-trifluoropropyl)-9H-purin-8-one?
The InChIKey is ICHNABWLGDNZCT-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H7F3N4O/c9-8(10,11)1-2-15-5-3-12-4-13-6(5)14-7(15)16/h3-4H,1-2H2,(H,12,13,14,16).
What are the key properties of 7-(3,3,3-trifluoropropyl)-9H-purin-8-one?
7-(3,3,3-trifluoropropyl)-9H-purin-8-one has a molecular weight of 232.16 g/mol, XLogP of 1.07, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 7-(3,3,3-trifluoropropyl)-9H-purin-8-one is sourced from PubChem (CID 175808735), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).