About 1-chloro-8-(1,1,1-trifluoropropan-2-yloxy)isoquinoline
1-chloro-8-(1,1,1-trifluoropropan-2-yloxy)isoquinoline (PubChem CID 175809270) has the molecular formula C12H9ClF3NO
and a molecular weight of 275.66 g/mol. Its IUPAC name is 1-chloro-8-(1,1,1-trifluoropropan-2-yloxy)isoquinoline.
Molecular Properties
| Compound Name | 1-chloro-8-(1,1,1-trifluoropropan-2-yloxy)isoquinoline |
| PubChem CID | 175809270 |
| Molecular Formula | C12H9ClF3NO |
| Molecular Weight | 275.66 g/mol |
| Exact Mass | 275.03 |
| IUPAC Name | 1-chloro-8-(1,1,1-trifluoropropan-2-yloxy)isoquinoline |
| SMILES | CC(Oc1cccc2ccnc(Cl)c12)C(F)(F)F |
| InChI | InChI=1S/C12H9ClF3NO/c1-7(12(14,15)16)18-9-4-2-3-8-5-6-17-11(13)10(8)9/h2-7H,1H3 |
| InChIKey | ZMBPIQYFZJYNFJ-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 275.66 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|
Analyze 1-chloro-8-(1,1,1-trifluoropropan-2-yloxy)isoquinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-chloro-8-(1,1,1-trifluoropropan-2-yloxy)isoquinoline?
The IUPAC name of 1-chloro-8-(1,1,1-trifluoropropan-2-yloxy)isoquinoline (CID 175809270) is 1-chloro-8-(1,1,1-trifluoropropan-2-yloxy)isoquinoline.
What is the SMILES notation for 1-chloro-8-(1,1,1-trifluoropropan-2-yloxy)isoquinoline?
The canonical SMILES for 1-chloro-8-(1,1,1-trifluoropropan-2-yloxy)isoquinoline is CC(Oc1cccc2ccnc(Cl)c12)C(F)(F)F.
What is the InChIKey of 1-chloro-8-(1,1,1-trifluoropropan-2-yloxy)isoquinoline?
The InChIKey is ZMBPIQYFZJYNFJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H9ClF3NO/c1-7(12(14,15)16)18-9-4-2-3-8-5-6-17-11(13)10(8)9/h2-7H,1H3.
What are the key properties of 1-chloro-8-(1,1,1-trifluoropropan-2-yloxy)isoquinoline?
1-chloro-8-(1,1,1-trifluoropropan-2-yloxy)isoquinoline has a molecular weight of 275.66 g/mol, XLogP of 4.22, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-chloro-8-(1,1,1-trifluoropropan-2-yloxy)isoquinoline is sourced from PubChem (CID 175809270), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).