C11H5F3N4 — CID 175809421
6-(3,4,5-trifluorophenyl)-1H-pyrazolo[3,4-b]pyrazine (PubChem CID 175809421) has the molecular formula C11H5F3N4 and a molecular weight of 250.18 g/mol. Its IUPAC name is 6-(3,4,5-trifluorophenyl)-1H-pyrazolo[3,4-b]pyrazine.
| Compound Name | 6-(3,4,5-trifluorophenyl)-1H-pyrazolo[3,4-b]pyrazine |
|---|---|
| PubChem CID | 175809421 |
| Molecular Formula | C11H5F3N4 |
| Molecular Weight | 250.18 g/mol |
| Exact Mass | 250.05 |
| IUPAC Name | 6-(3,4,5-trifluorophenyl)-1H-pyrazolo[3,4-b]pyrazine |
| SMILES | Fc1cc(-c2cnc3cn[nH]c3n2)cc(F)c1F |
| InChI | InChI=1S/C11H5F3N4/c12-6-1-5(2-7(13)10(6)14)8-3-15-9-4-16-18-11(9)17-8/h1-4H,(H,16,17,18) |
| InChIKey | PZESZPHTAWSYJW-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.18 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|