About 4-ethyl-6-methyl-1H-pyrimidine-2,4-diamine
4-ethyl-6-methyl-1H-pyrimidine-2,4-diamine (PubChem CID 175809532) has the molecular formula C7H14N4
and a molecular weight of 154.22 g/mol. Its IUPAC name is 4-ethyl-6-methyl-1H-pyrimidine-2,4-diamine.
Molecular Properties
| Compound Name | 4-ethyl-6-methyl-1H-pyrimidine-2,4-diamine |
| PubChem CID | 175809532 |
| Molecular Formula | C7H14N4 |
| Molecular Weight | 154.22 g/mol |
| Exact Mass | 154.12 |
| IUPAC Name | 4-ethyl-6-methyl-1H-pyrimidine-2,4-diamine |
| SMILES | CCC1(N)C=C(C)NC(N)=N1 |
| InChI | InChI=1S/C7H14N4/c1-3-7(9)4-5(2)10-6(8)11-7/h4H,3,9H2,1-2H3,(H3,8,10,11) |
| InChIKey | ZSPPYUGDTJPSGC-UHFFFAOYSA-N |
| XLogP | -0.13 |
| TPSA | 76.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 154.22 |
| LogP ≤ 5 | -0.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-ethyl-6-methyl-1H-pyrimidine-2,4-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-ethyl-6-methyl-1H-pyrimidine-2,4-diamine?
The IUPAC name of 4-ethyl-6-methyl-1H-pyrimidine-2,4-diamine (CID 175809532) is 4-ethyl-6-methyl-1H-pyrimidine-2,4-diamine.
What is the SMILES notation for 4-ethyl-6-methyl-1H-pyrimidine-2,4-diamine?
The canonical SMILES for 4-ethyl-6-methyl-1H-pyrimidine-2,4-diamine is CCC1(N)C=C(C)NC(N)=N1.
What is the InChIKey of 4-ethyl-6-methyl-1H-pyrimidine-2,4-diamine?
The InChIKey is ZSPPYUGDTJPSGC-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H14N4/c1-3-7(9)4-5(2)10-6(8)11-7/h4H,3,9H2,1-2H3,(H3,8,10,11).
What are the key properties of 4-ethyl-6-methyl-1H-pyrimidine-2,4-diamine?
4-ethyl-6-methyl-1H-pyrimidine-2,4-diamine has a molecular weight of 154.22 g/mol, XLogP of -0.13, 1 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-ethyl-6-methyl-1H-pyrimidine-2,4-diamine is sourced from PubChem (CID 175809532), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).