About 6-methyl-2-(1,3,4-thiadiazol-2-yl)pyridine-3-carboxamide
6-methyl-2-(1,3,4-thiadiazol-2-yl)pyridine-3-carboxamide (PubChem CID 175809995) has the molecular formula C9H8N4OS
and a molecular weight of 220.26 g/mol. Its IUPAC name is 6-methyl-2-(1,3,4-thiadiazol-2-yl)pyridine-3-carboxamide.
Molecular Properties
| Compound Name | 6-methyl-2-(1,3,4-thiadiazol-2-yl)pyridine-3-carboxamide |
| PubChem CID | 175809995 |
| Molecular Formula | C9H8N4OS |
| Molecular Weight | 220.26 g/mol |
| Exact Mass | 220.04 |
| IUPAC Name | 6-methyl-2-(1,3,4-thiadiazol-2-yl)pyridine-3-carboxamide |
| SMILES | Cc1ccc(C(N)=O)c(-c2nncs2)n1 |
| InChI | InChI=1S/C9H8N4OS/c1-5-2-3-6(8(10)14)7(12-5)9-13-11-4-15-9/h2-4H,1H3,(H2,10,14) |
| InChIKey | XPDKVPJDXWBPAA-UHFFFAOYSA-N |
| XLogP | 1.01 |
| TPSA | 81.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 220.26 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 6-methyl-2-(1,3,4-thiadiazol-2-yl)pyridine-3-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-methyl-2-(1,3,4-thiadiazol-2-yl)pyridine-3-carboxamide?
The IUPAC name of 6-methyl-2-(1,3,4-thiadiazol-2-yl)pyridine-3-carboxamide (CID 175809995) is 6-methyl-2-(1,3,4-thiadiazol-2-yl)pyridine-3-carboxamide.
What is the SMILES notation for 6-methyl-2-(1,3,4-thiadiazol-2-yl)pyridine-3-carboxamide?
The canonical SMILES for 6-methyl-2-(1,3,4-thiadiazol-2-yl)pyridine-3-carboxamide is Cc1ccc(C(N)=O)c(-c2nncs2)n1.
What is the InChIKey of 6-methyl-2-(1,3,4-thiadiazol-2-yl)pyridine-3-carboxamide?
The InChIKey is XPDKVPJDXWBPAA-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H8N4OS/c1-5-2-3-6(8(10)14)7(12-5)9-13-11-4-15-9/h2-4H,1H3,(H2,10,14).
What are the key properties of 6-methyl-2-(1,3,4-thiadiazol-2-yl)pyridine-3-carboxamide?
6-methyl-2-(1,3,4-thiadiazol-2-yl)pyridine-3-carboxamide has a molecular weight of 220.26 g/mol, XLogP of 1.01, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 6-methyl-2-(1,3,4-thiadiazol-2-yl)pyridine-3-carboxamide is sourced from PubChem (CID 175809995), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).