About 1,4-dichloro-2,5-dimethoxybenzene
1,4-dichloro-2,5-dimethoxybenzene (PubChem CID 17581) has the molecular formula C8H8Cl2O2
and a molecular weight of 207.06 g/mol. Its IUPAC name is 1,4-dichloro-2,5-dimethoxybenzene.
Molecular Properties
| Compound Name | 1,4-dichloro-2,5-dimethoxybenzene |
| PubChem CID | 17581 |
| Molecular Formula | C8H8Cl2O2 |
| Molecular Weight | 207.06 g/mol |
| Exact Mass | 205.99 |
| IUPAC Name | 1,4-dichloro-2,5-dimethoxybenzene |
| SMILES | COc1cc(Cl)c(OC)cc1Cl |
| InChI | InChI=1S/C8H8Cl2O2/c1-11-7-3-6(10)8(12-2)4-5(7)9/h3-4H,1-2H3 |
| InChIKey | PFIADAMVCJPXSF-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 207.06 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1,4-dichloro-2,5-dimethoxybenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,4-dichloro-2,5-dimethoxybenzene?
The IUPAC name of 1,4-dichloro-2,5-dimethoxybenzene (CID 17581) is 1,4-dichloro-2,5-dimethoxybenzene.
What is the SMILES notation for 1,4-dichloro-2,5-dimethoxybenzene?
The canonical SMILES for 1,4-dichloro-2,5-dimethoxybenzene is COc1cc(Cl)c(OC)cc1Cl.
What is the InChIKey of 1,4-dichloro-2,5-dimethoxybenzene?
The InChIKey is PFIADAMVCJPXSF-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8Cl2O2/c1-11-7-3-6(10)8(12-2)4-5(7)9/h3-4H,1-2H3.
What are the key properties of 1,4-dichloro-2,5-dimethoxybenzene?
1,4-dichloro-2,5-dimethoxybenzene has a molecular weight of 207.06 g/mol, XLogP of 3.01, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1,4-dichloro-2,5-dimethoxybenzene is sourced from PubChem (CID 17581), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).