About N-acetyl-2-(4-bromo-3,5-difluorophenyl)acetamide
N-acetyl-2-(4-bromo-3,5-difluorophenyl)acetamide (PubChem CID 175810346) has the molecular formula C10H8BrF2NO2
and a molecular weight of 292.08 g/mol. Its IUPAC name is N-acetyl-2-(4-bromo-3,5-difluorophenyl)acetamide.
Molecular Properties
| Compound Name | N-acetyl-2-(4-bromo-3,5-difluorophenyl)acetamide |
| PubChem CID | 175810346 |
| Molecular Formula | C10H8BrF2NO2 |
| Molecular Weight | 292.08 g/mol |
| Exact Mass | 290.97 |
| IUPAC Name | N-acetyl-2-(4-bromo-3,5-difluorophenyl)acetamide |
| SMILES | CC(=O)NC(=O)Cc1cc(F)c(Br)c(F)c1 |
| InChI | InChI=1S/C10H8BrF2NO2/c1-5(15)14-9(16)4-6-2-7(12)10(11)8(13)3-6/h2-3H,4H2,1H3,(H,14,15,16) |
| InChIKey | YBHBJKAJISPZMA-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 292.08 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|
Analyze N-acetyl-2-(4-bromo-3,5-difluorophenyl)acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-acetyl-2-(4-bromo-3,5-difluorophenyl)acetamide?
The IUPAC name of N-acetyl-2-(4-bromo-3,5-difluorophenyl)acetamide (CID 175810346) is N-acetyl-2-(4-bromo-3,5-difluorophenyl)acetamide.
What is the SMILES notation for N-acetyl-2-(4-bromo-3,5-difluorophenyl)acetamide?
The canonical SMILES for N-acetyl-2-(4-bromo-3,5-difluorophenyl)acetamide is CC(=O)NC(=O)Cc1cc(F)c(Br)c(F)c1.
What is the InChIKey of N-acetyl-2-(4-bromo-3,5-difluorophenyl)acetamide?
The InChIKey is YBHBJKAJISPZMA-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H8BrF2NO2/c1-5(15)14-9(16)4-6-2-7(12)10(11)8(13)3-6/h2-3H,4H2,1H3,(H,14,15,16).
What are the key properties of N-acetyl-2-(4-bromo-3,5-difluorophenyl)acetamide?
N-acetyl-2-(4-bromo-3,5-difluorophenyl)acetamide has a molecular weight of 292.08 g/mol, XLogP of 1.93, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-acetyl-2-(4-bromo-3,5-difluorophenyl)acetamide is sourced from PubChem (CID 175810346), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).