C20H33F7O2 — CID 175810657
1,1,1,4-tetrafluoro-2-(3,3,3-trifluoro-2-pentoxypropoxy)dodec-2-ene (PubChem CID 175810657) has the molecular formula C20H33F7O2 and a molecular weight of 438.47 g/mol. Its IUPAC name is 1,1,1,4-tetrafluoro-2-(3,3,3-trifluoro-2-pentoxypropoxy)dodec-2-ene.
| Compound Name | 1,1,1,4-tetrafluoro-2-(3,3,3-trifluoro-2-pentoxypropoxy)dodec-2-ene |
|---|---|
| PubChem CID | 175810657 |
| Molecular Formula | C20H33F7O2 |
| Molecular Weight | 438.47 g/mol |
| Exact Mass | 438.24 |
| IUPAC Name | 1,1,1,4-tetrafluoro-2-(3,3,3-trifluoro-2-pentoxypropoxy)dodec-2-ene |
| SMILES | CCCCCCCCC(F)C=C(OCC(OCCCCC)C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C20H33F7O2/c1-3-5-7-8-9-10-12-16(21)14-17(19(22,23)24)29-15-18(20(25,26)27)28-13-11-6-4-2/h14,16,18H,3-13,15H2,1-2H3 |
| InChIKey | ZPQPHTYUWJBZBJ-UHFFFAOYSA-N |
| XLogP | 7.68 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.47 |
| LogP ≤ 5 | 7.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|