About sodium;butan-1-olate;2-methyl-2-[(2-methylpropan-2-yl)oxy]propane
sodium;butan-1-olate;2-methyl-2-[(2-methylpropan-2-yl)oxy]propane (PubChem CID 175810945) has the molecular formula C12H27NaO2
and a molecular weight of 226.34 g/mol. Its IUPAC name is sodium;butan-1-olate;2-methyl-2-[(2-methylpropan-2-yl)oxy]propane.
Molecular Properties
| Compound Name | sodium;butan-1-olate;2-methyl-2-[(2-methylpropan-2-yl)oxy]propane |
| PubChem CID | 175810945 |
| Molecular Formula | C12H27NaO2 |
| Molecular Weight | 226.34 g/mol |
| Exact Mass | 226.19 |
| IUPAC Name | sodium;butan-1-olate;2-methyl-2-[(2-methylpropan-2-yl)oxy]propane |
| SMILES | CC(C)(C)OC(C)(C)C.CCCC[O-].[Na+] |
| InChI | InChI=1S/C8H18O.C4H9O.Na/c1-7(2,3)9-8(4,5)6;1-2-3-4-5;/h1-6H3;2-4H2,1H3;/q;-1;+1 |
| InChIKey | FEZKERDCKNQAIC-UHFFFAOYSA-N |
| XLogP | -0.25 |
| TPSA | 32.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 226.34 |
| LogP ≤ 5 | -0.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze sodium;butan-1-olate;2-methyl-2-[(2-methylpropan-2-yl)oxy]propane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium;butan-1-olate;2-methyl-2-[(2-methylpropan-2-yl)oxy]propane?
The IUPAC name of sodium;butan-1-olate;2-methyl-2-[(2-methylpropan-2-yl)oxy]propane (CID 175810945) is sodium;butan-1-olate;2-methyl-2-[(2-methylpropan-2-yl)oxy]propane.
What is the SMILES notation for sodium;butan-1-olate;2-methyl-2-[(2-methylpropan-2-yl)oxy]propane?
The canonical SMILES for sodium;butan-1-olate;2-methyl-2-[(2-methylpropan-2-yl)oxy]propane is CC(C)(C)OC(C)(C)C.CCCC[O-].[Na+].
What is the InChIKey of sodium;butan-1-olate;2-methyl-2-[(2-methylpropan-2-yl)oxy]propane?
The InChIKey is FEZKERDCKNQAIC-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H18O.C4H9O.Na/c1-7(2,3)9-8(4,5)6;1-2-3-4-5;/h1-6H3;2-4H2,1H3;/q;-1;+1.
What are the key properties of sodium;butan-1-olate;2-methyl-2-[(2-methylpropan-2-yl)oxy]propane?
sodium;butan-1-olate;2-methyl-2-[(2-methylpropan-2-yl)oxy]propane has a molecular weight of 226.34 g/mol, XLogP of -0.25, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for sodium;butan-1-olate;2-methyl-2-[(2-methylpropan-2-yl)oxy]propane is sourced from PubChem (CID 175810945), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).