C9H7N3 — CID 175811041
4-(2,3,4,5,6-pentadeuteriophenyl)triazine (PubChem CID 175811041) has the molecular formula C9H7N3 and a molecular weight of 162.21 g/mol. Its IUPAC name is 4-(2,3,4,5,6-pentadeuteriophenyl)triazine.
| Compound Name | 4-(2,3,4,5,6-pentadeuteriophenyl)triazine |
|---|---|
| PubChem CID | 175811041 |
| Molecular Formula | C9H7N3 |
| Molecular Weight | 162.21 g/mol |
| Exact Mass | 162.10 |
| IUPAC Name | 4-(2,3,4,5,6-pentadeuteriophenyl)triazine |
| SMILES | [2H]c1c([2H])c([2H])c(-c2ccnnn2)c([2H])c1[2H] |
| InChI | InChI=1S/C9H7N3/c1-2-4-8(5-3-1)9-6-7-10-12-11-9/h1-7H/i1D,2D,3D,4D,5D |
| InChIKey | YUXBNNVWBUTOQZ-RALIUCGRSA-N |
| XLogP | 1.54 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 162.21 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |