About bis(1,3-oxazol-5-yl)methanol
bis(1,3-oxazol-5-yl)methanol (PubChem CID 175811606) has the molecular formula C7H6N2O3
and a molecular weight of 166.14 g/mol. Its IUPAC name is bis(1,3-oxazol-5-yl)methanol.
Molecular Properties
| Compound Name | bis(1,3-oxazol-5-yl)methanol |
| PubChem CID | 175811606 |
| Molecular Formula | C7H6N2O3 |
| Molecular Weight | 166.14 g/mol |
| Exact Mass | 166.04 |
| IUPAC Name | bis(1,3-oxazol-5-yl)methanol |
| SMILES | OC(c1cnco1)c1cnco1 |
| InChI | InChI=1S/C7H6N2O3/c10-7(5-1-8-3-11-5)6-2-9-4-12-6/h1-4,7,10H |
| InChIKey | RZBFSVZGQRRAPM-UHFFFAOYSA-N |
| XLogP | 0.74 |
| TPSA | 72.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 166.14 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze bis(1,3-oxazol-5-yl)methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(1,3-oxazol-5-yl)methanol?
The IUPAC name of bis(1,3-oxazol-5-yl)methanol (CID 175811606) is bis(1,3-oxazol-5-yl)methanol.
What is the SMILES notation for bis(1,3-oxazol-5-yl)methanol?
The canonical SMILES for bis(1,3-oxazol-5-yl)methanol is OC(c1cnco1)c1cnco1.
What is the InChIKey of bis(1,3-oxazol-5-yl)methanol?
The InChIKey is RZBFSVZGQRRAPM-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H6N2O3/c10-7(5-1-8-3-11-5)6-2-9-4-12-6/h1-4,7,10H.
What are the key properties of bis(1,3-oxazol-5-yl)methanol?
bis(1,3-oxazol-5-yl)methanol has a molecular weight of 166.14 g/mol, XLogP of 0.74, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for bis(1,3-oxazol-5-yl)methanol is sourced from PubChem (CID 175811606), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).