C29H36O4 — CID 175812412
2-[[2,3,4-tris(oxiran-2-ylmethyl)-5-(3-phenylpentan-3-yl)phenyl]methyl]oxirane (PubChem CID 175812412) has the molecular formula C29H36O4 and a molecular weight of 448.60 g/mol. Its IUPAC name is 2-[[2,3,4-tris(oxiran-2-ylmethyl)-5-(3-phenylpentan-3-yl)phenyl]methyl]oxirane.
| Compound Name | 2-[[2,3,4-tris(oxiran-2-ylmethyl)-5-(3-phenylpentan-3-yl)phenyl]methyl]oxirane |
|---|---|
| PubChem CID | 175812412 |
| Molecular Formula | C29H36O4 |
| Molecular Weight | 448.60 g/mol |
| Exact Mass | 448.26 |
| IUPAC Name | 2-[[2,3,4-tris(oxiran-2-ylmethyl)-5-(3-phenylpentan-3-yl)phenyl]methyl]oxirane |
| SMILES | CCC(CC)(c1ccccc1)c1cc(CC2CO2)c(CC2CO2)c(CC2CO2)c1CC1CO1 |
| InChI | InChI=1S/C29H36O4/c1-3-29(4-2,20-8-6-5-7-9-20)28-11-19(10-21-15-30-21)25(12-22-16-31-22)26(13-23-17-32-23)27(28)14-24-18-33-24/h5-9,11,21-24H,3-4,10,12-18H2,1-2H3 |
| InChIKey | XXCBSVCMGYKJRX-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 50.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.60 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|