About 2-nitrobenzoic acid;(3-nitrophenyl)methylcarbamic acid
2-nitrobenzoic acid;(3-nitrophenyl)methylcarbamic acid (PubChem CID 175812990) has the molecular formula C15H13N3O8
and a molecular weight of 363.28 g/mol. Its IUPAC name is 2-nitrobenzoic acid;(3-nitrophenyl)methylcarbamic acid.
Molecular Properties
| Compound Name | 2-nitrobenzoic acid;(3-nitrophenyl)methylcarbamic acid |
| PubChem CID | 175812990 |
| Molecular Formula | C15H13N3O8 |
| Molecular Weight | 363.28 g/mol |
| Exact Mass | 363.07 |
| IUPAC Name | 2-nitrobenzoic acid;(3-nitrophenyl)methylcarbamic acid |
| SMILES | O=C(O)NCc1cccc([N+](=O)[O-])c1.O=C(O)c1ccccc1[N+](=O)[O-] |
| InChI | InChI=1S/C8H8N2O4.C7H5NO4/c11-8(12)9-5-6-2-1-3-7(4-6)10(13)14;9-7(10)5-3-1-2-4-6(5)8(11)12/h1-4,9H,5H2,(H,11,12);1-4H,(H,9,10) |
| InChIKey | FXMMUSLAMAWBKF-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 172.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 363.28 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-nitrobenzoic acid;(3-nitrophenyl)methylcarbamic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-nitrobenzoic acid;(3-nitrophenyl)methylcarbamic acid?
The IUPAC name of 2-nitrobenzoic acid;(3-nitrophenyl)methylcarbamic acid (CID 175812990) is 2-nitrobenzoic acid;(3-nitrophenyl)methylcarbamic acid.
What is the SMILES notation for 2-nitrobenzoic acid;(3-nitrophenyl)methylcarbamic acid?
The canonical SMILES for 2-nitrobenzoic acid;(3-nitrophenyl)methylcarbamic acid is O=C(O)NCc1cccc([N+](=O)[O-])c1.O=C(O)c1ccccc1[N+](=O)[O-].
What is the InChIKey of 2-nitrobenzoic acid;(3-nitrophenyl)methylcarbamic acid?
The InChIKey is FXMMUSLAMAWBKF-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8N2O4.C7H5NO4/c11-8(12)9-5-6-2-1-3-7(4-6)10(13)14;9-7(10)5-3-1-2-4-6(5)8(11)12/h1-4,9H,5H2,(H,11,12);1-4H,(H,9,10).
What are the key properties of 2-nitrobenzoic acid;(3-nitrophenyl)methylcarbamic acid?
2-nitrobenzoic acid;(3-nitrophenyl)methylcarbamic acid has a molecular weight of 363.28 g/mol, XLogP of 2.66, 5 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-nitrobenzoic acid;(3-nitrophenyl)methylcarbamic acid is sourced from PubChem (CID 175812990), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).