C26H29F3N4O4 — CID 175813141
(8R)-4-[[(1R)-1-[3-[(2R)-1,1-difluoro-2,3-dihydroxy-2-methylpropyl]-2-fluorophenyl]ethyl]amino]-8-methoxy-2,6,8-trimethylpyrrolo[2,3-g]quinazolin-7-one (PubChem CID 175813141) has the molecular formula C26H29F3N4O4 and a molecular weight of 518.54 g/mol. Its IUPAC name is (8R)-4-[[(1R)-1-[3-[(2R)-1,1-difluoro-2,3-dihydroxy-2-methylpropyl]-2-fluorophenyl]ethyl]amino]-8-methoxy-2,6,8-trimethylpyrrolo[2,3-g]quinazolin-7-one.
| Compound Name | (8R)-4-[[(1R)-1-[3-[(2R)-1,1-difluoro-2,3-dihydroxy-2-methylpropyl]-2-fluorophenyl]ethyl]amino]-8-methoxy-2,6,8-trimethylpyrrolo[2,3-g]quinazolin-7-one |
|---|---|
| PubChem CID | 175813141 |
| Molecular Formula | C26H29F3N4O4 |
| Molecular Weight | 518.54 g/mol |
| Exact Mass | 518.21 |
| IUPAC Name | (8R)-4-[[(1R)-1-[3-[(2R)-1,1-difluoro-2,3-dihydroxy-2-methylpropyl]-2-fluorophenyl]ethyl]amino]-8-methoxy-2,6,8-trimethylpyrrolo[2,3-g]quinazolin-7-one |
| SMILES | CO[C@@]1(C)C(=O)N(C)c2cc3c(N[C@H](C)c4cccc(C(F)(F)[C@](C)(O)CO)c4F)nc(C)nc3cc21 |
| InChI | InChI=1S/C26H29F3N4O4/c1-13(15-8-7-9-17(21(15)27)26(28,29)24(3,36)12-34)30-22-16-10-20-18(11-19(16)31-14(2)32-22)25(4,37-6)23(35)33(20)5/h7-11,13,34,36H,12H2,1-6H3,(H,30,31,32)/t13-,24-,25-/m1/s1 |
| InChIKey | JPMNAYJGXWEQJL-ZTSHRCRKSA-N |
| XLogP | 3.92 |
| TPSA | 107.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.54 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |