About 8,9-dihydro-6H-pyrazino[2,3-g]quinazolin-7-one
8,9-dihydro-6H-pyrazino[2,3-g]quinazolin-7-one (PubChem CID 175813238) has the molecular formula C10H8N4O
and a molecular weight of 200.20 g/mol. Its IUPAC name is 8,9-dihydro-6H-pyrazino[2,3-g]quinazolin-7-one.
Molecular Properties
| Compound Name | 8,9-dihydro-6H-pyrazino[2,3-g]quinazolin-7-one |
| PubChem CID | 175813238 |
| Molecular Formula | C10H8N4O |
| Molecular Weight | 200.20 g/mol |
| Exact Mass | 200.07 |
| IUPAC Name | 8,9-dihydro-6H-pyrazino[2,3-g]quinazolin-7-one |
| SMILES | O=C1CNc2cc3ncncc3cc2N1 |
| InChI | InChI=1S/C10H8N4O/c15-10-4-12-8-2-7-6(1-9(8)14-10)3-11-5-13-7/h1-3,5,12H,4H2,(H,14,15) |
| InChIKey | NJHSLPZNUWNQPY-UHFFFAOYSA-N |
| XLogP | 0.99 |
| TPSA | 66.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 200.20 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 8,9-dihydro-6H-pyrazino[2,3-g]quinazolin-7-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8,9-dihydro-6H-pyrazino[2,3-g]quinazolin-7-one?
The IUPAC name of 8,9-dihydro-6H-pyrazino[2,3-g]quinazolin-7-one (CID 175813238) is 8,9-dihydro-6H-pyrazino[2,3-g]quinazolin-7-one.
What is the SMILES notation for 8,9-dihydro-6H-pyrazino[2,3-g]quinazolin-7-one?
The canonical SMILES for 8,9-dihydro-6H-pyrazino[2,3-g]quinazolin-7-one is O=C1CNc2cc3ncncc3cc2N1.
What is the InChIKey of 8,9-dihydro-6H-pyrazino[2,3-g]quinazolin-7-one?
The InChIKey is NJHSLPZNUWNQPY-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H8N4O/c15-10-4-12-8-2-7-6(1-9(8)14-10)3-11-5-13-7/h1-3,5,12H,4H2,(H,14,15).
What are the key properties of 8,9-dihydro-6H-pyrazino[2,3-g]quinazolin-7-one?
8,9-dihydro-6H-pyrazino[2,3-g]quinazolin-7-one has a molecular weight of 200.20 g/mol, XLogP of 0.99, 0 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 8,9-dihydro-6H-pyrazino[2,3-g]quinazolin-7-one is sourced from PubChem (CID 175813238), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).