About tert-butyl 4-(2-ethoxy-2-oxoethyl)piperazine-1-carboxylate;ethyl 2-piperazin-1-ylacetate
tert-butyl 4-(2-ethoxy-2-oxoethyl)piperazine-1-carboxylate;ethyl 2-piperazin-1-ylacetate (PubChem CID 175813809) has the molecular formula C21H40N4O6
and a molecular weight of 444.57 g/mol. Its IUPAC name is tert-butyl 4-(2-ethoxy-2-oxoethyl)piperazine-1-carboxylate;ethyl 2-piperazin-1-ylacetate.
Molecular Properties
| Compound Name | tert-butyl 4-(2-ethoxy-2-oxoethyl)piperazine-1-carboxylate;ethyl 2-piperazin-1-ylacetate |
| PubChem CID | 175813809 |
| Molecular Formula | C21H40N4O6 |
| Molecular Weight | 444.57 g/mol |
| Exact Mass | 444.29 |
| IUPAC Name | tert-butyl 4-(2-ethoxy-2-oxoethyl)piperazine-1-carboxylate;ethyl 2-piperazin-1-ylacetate |
| SMILES | CCOC(=O)CN1CCN(C(=O)OC(C)(C)C)CC1.CCOC(=O)CN1CCNCC1 |
| InChI | InChI=1S/C13H24N2O4.C8H16N2O2/c1-5-18-11(16)10-14-6-8-15(9-7-14)12(17)19-13(2,3)4;1-2-12-8(11)7-10-5-3-9-4-6-10/h5-10H2,1-4H3;9H,2-7H2,1H3 |
| InChIKey | XKSDUXBRKCHLLY-UHFFFAOYSA-N |
| XLogP | 0.56 |
| TPSA | 100.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 444.57 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|
Analyze tert-butyl 4-(2-ethoxy-2-oxoethyl)piperazine-1-carboxylate;ethyl 2-piperazin-1-ylacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl 4-(2-ethoxy-2-oxoethyl)piperazine-1-carboxylate;ethyl 2-piperazin-1-ylacetate?
The IUPAC name of tert-butyl 4-(2-ethoxy-2-oxoethyl)piperazine-1-carboxylate;ethyl 2-piperazin-1-ylacetate (CID 175813809) is tert-butyl 4-(2-ethoxy-2-oxoethyl)piperazine-1-carboxylate;ethyl 2-piperazin-1-ylacetate.
What is the SMILES notation for tert-butyl 4-(2-ethoxy-2-oxoethyl)piperazine-1-carboxylate;ethyl 2-piperazin-1-ylacetate?
The canonical SMILES for tert-butyl 4-(2-ethoxy-2-oxoethyl)piperazine-1-carboxylate;ethyl 2-piperazin-1-ylacetate is CCOC(=O)CN1CCN(C(=O)OC(C)(C)C)CC1.CCOC(=O)CN1CCNCC1.
What is the InChIKey of tert-butyl 4-(2-ethoxy-2-oxoethyl)piperazine-1-carboxylate;ethyl 2-piperazin-1-ylacetate?
The InChIKey is XKSDUXBRKCHLLY-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H24N2O4.C8H16N2O2/c1-5-18-11(16)10-14-6-8-15(9-7-14)12(17)19-13(2,3)4;1-2-12-8(11)7-10-5-3-9-4-6-10/h5-10H2,1-4H3;9H,2-7H2,1H3.
What are the key properties of tert-butyl 4-(2-ethoxy-2-oxoethyl)piperazine-1-carboxylate;ethyl 2-piperazin-1-ylacetate?
tert-butyl 4-(2-ethoxy-2-oxoethyl)piperazine-1-carboxylate;ethyl 2-piperazin-1-ylacetate has a molecular weight of 444.57 g/mol, XLogP of 0.56, 6 rotatable bonds, 1 hydrogen bond donors, and 9 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl 4-(2-ethoxy-2-oxoethyl)piperazine-1-carboxylate;ethyl 2-piperazin-1-ylacetate is sourced from PubChem (CID 175813809), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).