C11H14N2O — CID 175814951
N-(1-methylcyclobutyl)pyridine-2-carboxamide (PubChem CID 175814951) has the molecular formula C11H14N2O and a molecular weight of 190.25 g/mol. Its IUPAC name is N-(1-methylcyclobutyl)pyridine-2-carboxamide.
| Compound Name | N-(1-methylcyclobutyl)pyridine-2-carboxamide |
|---|---|
| PubChem CID | 175814951 |
| Molecular Formula | C11H14N2O |
| Molecular Weight | 190.25 g/mol |
| Exact Mass | 190.11 |
| IUPAC Name | N-(1-methylcyclobutyl)pyridine-2-carboxamide |
| SMILES | CC1(NC(=O)c2ccccn2)CCC1 |
| InChI | InChI=1S/C11H14N2O/c1-11(6-4-7-11)13-10(14)9-5-2-3-8-12-9/h2-3,5,8H,4,6-7H2,1H3,(H,13,14) |
| InChIKey | MCVPKJIKDXYVAA-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.25 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |