About potassium 3-chloro-5-[(5-chloro-7,8-dihydro-6H-naphthalen-6-id-2-yl)oxymethyl]-1-propan-2-ylindazole
potassium 3-chloro-5-[(5-chloro-7,8-dihydro-6H-naphthalen-6-id-2-yl)oxymethyl]-1-propan-2-ylindazole (PubChem CID 175815987) has the molecular formula C21H19Cl2KN2O
and a molecular weight of 425.40 g/mol. Its IUPAC name is potassium 3-chloro-5-[(5-chloro-7,8-dihydro-6H-naphthalen-6-id-2-yl)oxymethyl]-1-propan-2-ylindazole.
Molecular Properties
| Compound Name | potassium 3-chloro-5-[(5-chloro-7,8-dihydro-6H-naphthalen-6-id-2-yl)oxymethyl]-1-propan-2-ylindazole |
| PubChem CID | 175815987 |
| Molecular Formula | C21H19Cl2KN2O |
| Molecular Weight | 425.40 g/mol |
| Exact Mass | 424.05 |
| IUPAC Name | potassium 3-chloro-5-[(5-chloro-7,8-dihydro-6H-naphthalen-6-id-2-yl)oxymethyl]-1-propan-2-ylindazole |
| SMILES | CC(C)n1nc(Cl)c2cc(COc3ccc4c(c3)CC[C-]=C4Cl)ccc21.[K+] |
| InChI | InChI=1S/C21H19Cl2N2O.K/c1-13(2)25-20-9-6-14(10-18(20)21(23)24-25)12-26-16-7-8-17-15(11-16)4-3-5-19(17)22;/h6-11,13H,3-4,12H2,1-2H3;/q-1;+1 |
| InChIKey | UPUKPVSAPLMHEA-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 27.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 425.40 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze potassium 3-chloro-5-[(5-chloro-7,8-dihydro-6H-naphthalen-6-id-2-yl)oxymethyl]-1-propan-2-ylindazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of potassium 3-chloro-5-[(5-chloro-7,8-dihydro-6H-naphthalen-6-id-2-yl)oxymethyl]-1-propan-2-ylindazole?
The IUPAC name of potassium 3-chloro-5-[(5-chloro-7,8-dihydro-6H-naphthalen-6-id-2-yl)oxymethyl]-1-propan-2-ylindazole (CID 175815987) is potassium 3-chloro-5-[(5-chloro-7,8-dihydro-6H-naphthalen-6-id-2-yl)oxymethyl]-1-propan-2-ylindazole.
What is the SMILES notation for potassium 3-chloro-5-[(5-chloro-7,8-dihydro-6H-naphthalen-6-id-2-yl)oxymethyl]-1-propan-2-ylindazole?
The canonical SMILES for potassium 3-chloro-5-[(5-chloro-7,8-dihydro-6H-naphthalen-6-id-2-yl)oxymethyl]-1-propan-2-ylindazole is CC(C)n1nc(Cl)c2cc(COc3ccc4c(c3)CC[C-]=C4Cl)ccc21.[K+].
What is the InChIKey of potassium 3-chloro-5-[(5-chloro-7,8-dihydro-6H-naphthalen-6-id-2-yl)oxymethyl]-1-propan-2-ylindazole?
The InChIKey is UPUKPVSAPLMHEA-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H19Cl2N2O.K/c1-13(2)25-20-9-6-14(10-18(20)21(23)24-25)12-26-16-7-8-17-15(11-16)4-3-5-19(17)22;/h6-11,13H,3-4,12H2,1-2H3;/q-1;+1.
What are the key properties of potassium 3-chloro-5-[(5-chloro-7,8-dihydro-6H-naphthalen-6-id-2-yl)oxymethyl]-1-propan-2-ylindazole?
potassium 3-chloro-5-[(5-chloro-7,8-dihydro-6H-naphthalen-6-id-2-yl)oxymethyl]-1-propan-2-ylindazole has a molecular weight of 425.40 g/mol, XLogP of 3.18, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for potassium 3-chloro-5-[(5-chloro-7,8-dihydro-6H-naphthalen-6-id-2-yl)oxymethyl]-1-propan-2-ylindazole is sourced from PubChem (CID 175815987), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).