About 5-deuterio-2,3-dihydro-1-benzofuran-7-amine
5-deuterio-2,3-dihydro-1-benzofuran-7-amine (PubChem CID 175816446) has the molecular formula C8H9NO
and a molecular weight of 136.17 g/mol. Its IUPAC name is 5-deuterio-2,3-dihydro-1-benzofuran-7-amine.
Molecular Properties
| Compound Name | 5-deuterio-2,3-dihydro-1-benzofuran-7-amine |
| PubChem CID | 175816446 |
| Molecular Formula | C8H9NO |
| Molecular Weight | 136.17 g/mol |
| Exact Mass | 136.07 |
| IUPAC Name | 5-deuterio-2,3-dihydro-1-benzofuran-7-amine |
| SMILES | [2H]c1cc(N)c2c(c1)CCO2 |
| InChI | InChI=1S/C8H9NO/c9-7-3-1-2-6-4-5-10-8(6)7/h1-3H,4-5,9H2/i1D |
| InChIKey | UHHZGSLXPQGPJL-MICDWDOJSA-N |
| XLogP | 1.20 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 136.17 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 5-deuterio-2,3-dihydro-1-benzofuran-7-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-deuterio-2,3-dihydro-1-benzofuran-7-amine?
The IUPAC name of 5-deuterio-2,3-dihydro-1-benzofuran-7-amine (CID 175816446) is 5-deuterio-2,3-dihydro-1-benzofuran-7-amine.
What is the SMILES notation for 5-deuterio-2,3-dihydro-1-benzofuran-7-amine?
The canonical SMILES for 5-deuterio-2,3-dihydro-1-benzofuran-7-amine is [2H]c1cc(N)c2c(c1)CCO2.
What is the InChIKey of 5-deuterio-2,3-dihydro-1-benzofuran-7-amine?
The InChIKey is UHHZGSLXPQGPJL-MICDWDOJSA-N. The full InChI is InChI=1S/C8H9NO/c9-7-3-1-2-6-4-5-10-8(6)7/h1-3H,4-5,9H2/i1D.
What are the key properties of 5-deuterio-2,3-dihydro-1-benzofuran-7-amine?
5-deuterio-2,3-dihydro-1-benzofuran-7-amine has a molecular weight of 136.17 g/mol, XLogP of 1.20, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-deuterio-2,3-dihydro-1-benzofuran-7-amine is sourced from PubChem (CID 175816446), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).