C30H52O2 — CID 175816594
[(9Z,11Z)-tetradeca-9,11-dienyl] (11Z,13Z)-hexadeca-11,13-dienoate (PubChem CID 175816594) has the molecular formula C30H52O2 and a molecular weight of 444.74 g/mol. Its IUPAC name is [(9Z,11Z)-tetradeca-9,11-dienyl] (11Z,13Z)-hexadeca-11,13-dienoate.
| Compound Name | [(9Z,11Z)-tetradeca-9,11-dienyl] (11Z,13Z)-hexadeca-11,13-dienoate |
|---|---|
| PubChem CID | 175816594 |
| Molecular Formula | C30H52O2 |
| Molecular Weight | 444.74 g/mol |
| Exact Mass | 444.40 |
| IUPAC Name | [(9Z,11Z)-tetradeca-9,11-dienyl] (11Z,13Z)-hexadeca-11,13-dienoate |
| SMILES | CC/C=C\C=C/CCCCCCCCCC(=O)OCCCCCCCC/C=C\C=C/CC |
| InChI | InChI=1S/C30H52O2/c1-3-5-7-9-11-13-15-17-18-20-22-24-26-28-30(31)32-29-27-25-23-21-19-16-14-12-10-8-6-4-2/h5-12H,3-4,13-29H2,1-2H3/b7-5-,8-6-,11-9-,12-10- |
| InChIKey | IYLLOZWVWSIUGI-CAVFYFSLSA-N |
| XLogP | 9.82 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.74 |
| LogP ≤ 5 | 9.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|