C22H22F3N7O3S — CID 175816665
1-[1-[10-(4-methylphenyl)sulfonyl-3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaen-3-yl]pyrrolidin-3-yl]-3-(2,2,2-trifluoroethyl)urea (PubChem CID 175816665) has the molecular formula C22H22F3N7O3S and a molecular weight of 521.53 g/mol. Its IUPAC name is 1-[1-[10-(4-methylphenyl)sulfonyl-3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaen-3-yl]pyrrolidin-3-yl]-3-(2,2,2-trifluoroethyl)urea.
| Compound Name | 1-[1-[10-(4-methylphenyl)sulfonyl-3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaen-3-yl]pyrrolidin-3-yl]-3-(2,2,2-trifluoroethyl)urea |
|---|---|
| PubChem CID | 175816665 |
| Molecular Formula | C22H22F3N7O3S |
| Molecular Weight | 521.53 g/mol |
| Exact Mass | 521.15 |
| IUPAC Name | 1-[1-[10-(4-methylphenyl)sulfonyl-3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaen-3-yl]pyrrolidin-3-yl]-3-(2,2,2-trifluoroethyl)urea |
| SMILES | Cc1ccc(S(=O)(=O)n2ccc3c4c(cnc32)ncn4N2CCC(NC(=O)NCC(F)(F)F)C2)cc1 |
| InChI | InChI=1S/C22H22F3N7O3S/c1-14-2-4-16(5-3-14)36(34,35)32-9-7-17-19-18(10-26-20(17)32)28-13-31(19)30-8-6-15(11-30)29-21(33)27-12-22(23,24)25/h2-5,7,9-10,13,15H,6,8,11-12H2,1H3,(H2,27,29,33) |
| InChIKey | HPUJYYPPXILUFG-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 114.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.53 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |