About 3,6-diphenyl-2,4-dihydro-1,3-thiazine
3,6-diphenyl-2,4-dihydro-1,3-thiazine (PubChem CID 175817384) has the molecular formula C16H15NS
and a molecular weight of 253.37 g/mol. Its IUPAC name is 3,6-diphenyl-2,4-dihydro-1,3-thiazine.
Molecular Properties
| Compound Name | 3,6-diphenyl-2,4-dihydro-1,3-thiazine |
| PubChem CID | 175817384 |
| Molecular Formula | C16H15NS |
| Molecular Weight | 253.37 g/mol |
| Exact Mass | 253.09 |
| IUPAC Name | 3,6-diphenyl-2,4-dihydro-1,3-thiazine |
| SMILES | C1=C(c2ccccc2)SCN(c2ccccc2)C1 |
| InChI | InChI=1S/C16H15NS/c1-3-7-14(8-4-1)16-11-12-17(13-18-16)15-9-5-2-6-10-15/h1-11H,12-13H2 |
| InChIKey | URGNGBISUCQOCB-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 253.37 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3,6-diphenyl-2,4-dihydro-1,3-thiazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,6-diphenyl-2,4-dihydro-1,3-thiazine?
The IUPAC name of 3,6-diphenyl-2,4-dihydro-1,3-thiazine (CID 175817384) is 3,6-diphenyl-2,4-dihydro-1,3-thiazine.
What is the SMILES notation for 3,6-diphenyl-2,4-dihydro-1,3-thiazine?
The canonical SMILES for 3,6-diphenyl-2,4-dihydro-1,3-thiazine is C1=C(c2ccccc2)SCN(c2ccccc2)C1.
What is the InChIKey of 3,6-diphenyl-2,4-dihydro-1,3-thiazine?
The InChIKey is URGNGBISUCQOCB-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H15NS/c1-3-7-14(8-4-1)16-11-12-17(13-18-16)15-9-5-2-6-10-15/h1-11H,12-13H2.
What are the key properties of 3,6-diphenyl-2,4-dihydro-1,3-thiazine?
3,6-diphenyl-2,4-dihydro-1,3-thiazine has a molecular weight of 253.37 g/mol, XLogP of 4.24, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3,6-diphenyl-2,4-dihydro-1,3-thiazine is sourced from PubChem (CID 175817384), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).