About 4-(2,2,2-trifluoroethoxy)quinazoline-6-carbaldehyde
4-(2,2,2-trifluoroethoxy)quinazoline-6-carbaldehyde (PubChem CID 175818168) has the molecular formula C11H7F3N2O2
and a molecular weight of 256.18 g/mol. Its IUPAC name is 4-(2,2,2-trifluoroethoxy)quinazoline-6-carbaldehyde.
Molecular Properties
| Compound Name | 4-(2,2,2-trifluoroethoxy)quinazoline-6-carbaldehyde |
| PubChem CID | 175818168 |
| Molecular Formula | C11H7F3N2O2 |
| Molecular Weight | 256.18 g/mol |
| Exact Mass | 256.05 |
| IUPAC Name | 4-(2,2,2-trifluoroethoxy)quinazoline-6-carbaldehyde |
| SMILES | O=Cc1ccc2ncnc(OCC(F)(F)F)c2c1 |
| InChI | InChI=1S/C11H7F3N2O2/c12-11(13,14)5-18-10-8-3-7(4-17)1-2-9(8)15-6-16-10/h1-4,6H,5H2 |
| InChIKey | RYRASRWUEFBEGD-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 52.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 256.18 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 4-(2,2,2-trifluoroethoxy)quinazoline-6-carbaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(2,2,2-trifluoroethoxy)quinazoline-6-carbaldehyde?
The IUPAC name of 4-(2,2,2-trifluoroethoxy)quinazoline-6-carbaldehyde (CID 175818168) is 4-(2,2,2-trifluoroethoxy)quinazoline-6-carbaldehyde.
What is the SMILES notation for 4-(2,2,2-trifluoroethoxy)quinazoline-6-carbaldehyde?
The canonical SMILES for 4-(2,2,2-trifluoroethoxy)quinazoline-6-carbaldehyde is O=Cc1ccc2ncnc(OCC(F)(F)F)c2c1.
What is the InChIKey of 4-(2,2,2-trifluoroethoxy)quinazoline-6-carbaldehyde?
The InChIKey is RYRASRWUEFBEGD-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H7F3N2O2/c12-11(13,14)5-18-10-8-3-7(4-17)1-2-9(8)15-6-16-10/h1-4,6H,5H2.
What are the key properties of 4-(2,2,2-trifluoroethoxy)quinazoline-6-carbaldehyde?
4-(2,2,2-trifluoroethoxy)quinazoline-6-carbaldehyde has a molecular weight of 256.18 g/mol, XLogP of 2.38, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(2,2,2-trifluoroethoxy)quinazoline-6-carbaldehyde is sourced from PubChem (CID 175818168), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).