C24H30N6O6S — CID 175818881
(7,7-dimethyl-2-oxo-1-bicyclo[2.2.1]heptanyl)methanesulfonic acid;2-[3-[1-(2-nitrophenyl)pyrrol-2-yl]prop-2-enylideneamino]guanidine (PubChem CID 175818881) has the molecular formula C24H30N6O6S and a molecular weight of 530.61 g/mol. Its IUPAC name is (7,7-dimethyl-2-oxo-1-bicyclo[2.2.1]heptanyl)methanesulfonic acid;2-[3-[1-(2-nitrophenyl)pyrrol-2-yl]prop-2-enylideneamino]guanidine.
| Compound Name | (7,7-dimethyl-2-oxo-1-bicyclo[2.2.1]heptanyl)methanesulfonic acid;2-[3-[1-(2-nitrophenyl)pyrrol-2-yl]prop-2-enylideneamino]guanidine |
|---|---|
| PubChem CID | 175818881 |
| Molecular Formula | C24H30N6O6S |
| Molecular Weight | 530.61 g/mol |
| Exact Mass | 530.19 |
| IUPAC Name | (7,7-dimethyl-2-oxo-1-bicyclo[2.2.1]heptanyl)methanesulfonic acid;2-[3-[1-(2-nitrophenyl)pyrrol-2-yl]prop-2-enylideneamino]guanidine |
| SMILES | CC1(C)C2CCC1(CS(=O)(=O)O)C(=O)C2.NC(N)=NN=CC=Cc1cccn1-c1ccccc1[N+](=O)[O-] |
| InChI | InChI=1S/C14H14N6O2.C10H16O4S/c15-14(16)18-17-9-3-5-11-6-4-10-19(11)12-7-1-2-8-13(12)20(21)22;1-9(2)7-3-4-10(9,8(11)5-7)6-15(12,13)14/h1-10H,(H4,15,16,18);7H,3-6H2,1-2H3,(H,12,13,14) |
| InChIKey | TVTAWKQZSFEIAM-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 196.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.61 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_imine_B(3)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|