About N-[1-methyl-3-[(2R)-1,1,1-trifluoropropan-2-yl]oxypyrazol-4-yl]formamide
N-[1-methyl-3-[(2R)-1,1,1-trifluoropropan-2-yl]oxypyrazol-4-yl]formamide (PubChem CID 175819606) has the molecular formula C8H10F3N3O2
and a molecular weight of 237.18 g/mol. Its IUPAC name is N-[1-methyl-3-[(2R)-1,1,1-trifluoropropan-2-yl]oxypyrazol-4-yl]formamide.
Molecular Properties
| Compound Name | N-[1-methyl-3-[(2R)-1,1,1-trifluoropropan-2-yl]oxypyrazol-4-yl]formamide |
| PubChem CID | 175819606 |
| Molecular Formula | C8H10F3N3O2 |
| Molecular Weight | 237.18 g/mol |
| Exact Mass | 237.07 |
| IUPAC Name | N-[1-methyl-3-[(2R)-1,1,1-trifluoropropan-2-yl]oxypyrazol-4-yl]formamide |
| SMILES | C[C@@H](Oc1nn(C)cc1NC=O)C(F)(F)F |
| InChI | InChI=1S/C8H10F3N3O2/c1-5(8(9,10)11)16-7-6(12-4-15)3-14(2)13-7/h3-5H,1-2H3,(H,12,15)/t5-/m1/s1 |
| InChIKey | SNMBFHDXZWPYMM-RXMQYKEDSA-N |
| XLogP | 1.32 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 237.18 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze N-[1-methyl-3-[(2R)-1,1,1-trifluoropropan-2-yl]oxypyrazol-4-yl]formamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[1-methyl-3-[(2R)-1,1,1-trifluoropropan-2-yl]oxypyrazol-4-yl]formamide?
The IUPAC name of N-[1-methyl-3-[(2R)-1,1,1-trifluoropropan-2-yl]oxypyrazol-4-yl]formamide (CID 175819606) is N-[1-methyl-3-[(2R)-1,1,1-trifluoropropan-2-yl]oxypyrazol-4-yl]formamide.
What is the SMILES notation for N-[1-methyl-3-[(2R)-1,1,1-trifluoropropan-2-yl]oxypyrazol-4-yl]formamide?
The canonical SMILES for N-[1-methyl-3-[(2R)-1,1,1-trifluoropropan-2-yl]oxypyrazol-4-yl]formamide is C[C@@H](Oc1nn(C)cc1NC=O)C(F)(F)F.
What is the InChIKey of N-[1-methyl-3-[(2R)-1,1,1-trifluoropropan-2-yl]oxypyrazol-4-yl]formamide?
The InChIKey is SNMBFHDXZWPYMM-RXMQYKEDSA-N. The full InChI is InChI=1S/C8H10F3N3O2/c1-5(8(9,10)11)16-7-6(12-4-15)3-14(2)13-7/h3-5H,1-2H3,(H,12,15)/t5-/m1/s1.
What are the key properties of N-[1-methyl-3-[(2R)-1,1,1-trifluoropropan-2-yl]oxypyrazol-4-yl]formamide?
N-[1-methyl-3-[(2R)-1,1,1-trifluoropropan-2-yl]oxypyrazol-4-yl]formamide has a molecular weight of 237.18 g/mol, XLogP of 1.32, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-[1-methyl-3-[(2R)-1,1,1-trifluoropropan-2-yl]oxypyrazol-4-yl]formamide is sourced from PubChem (CID 175819606), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).