C17H29NO3Si — CID 175821213
morpholin-4-yl-[4-(2-trimethylsilylethoxymethyl)cyclohexa-1,5-dien-1-yl]methanone (PubChem CID 175821213) has the molecular formula C17H29NO3Si and a molecular weight of 323.51 g/mol. Its IUPAC name is morpholin-4-yl-[4-(2-trimethylsilylethoxymethyl)cyclohexa-1,5-dien-1-yl]methanone.
| Compound Name | morpholin-4-yl-[4-(2-trimethylsilylethoxymethyl)cyclohexa-1,5-dien-1-yl]methanone |
|---|---|
| PubChem CID | 175821213 |
| Molecular Formula | C17H29NO3Si |
| Molecular Weight | 323.51 g/mol |
| Exact Mass | 323.19 |
| IUPAC Name | morpholin-4-yl-[4-(2-trimethylsilylethoxymethyl)cyclohexa-1,5-dien-1-yl]methanone |
| SMILES | C[Si](C)(C)CCOCC1C=CC(C(=O)N2CCOCC2)=CC1 |
| InChI | InChI=1S/C17H29NO3Si/c1-22(2,3)13-12-21-14-15-4-6-16(7-5-15)17(19)18-8-10-20-11-9-18/h4,6-7,15H,5,8-14H2,1-3H3 |
| InChIKey | WQMBYSVTPJYACL-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.51 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|