C21H17N5 — CID 175822709
2-(1H-imidazo[4,5-f][1,10]phenanthrolin-2-yl)-N,N-dimethylaniline (PubChem CID 175822709) has the molecular formula C21H17N5 and a molecular weight of 339.40 g/mol. Its IUPAC name is 2-(1H-imidazo[4,5-f][1,10]phenanthrolin-2-yl)-N,N-dimethylaniline.
| Compound Name | 2-(1H-imidazo[4,5-f][1,10]phenanthrolin-2-yl)-N,N-dimethylaniline |
|---|---|
| PubChem CID | 175822709 |
| Molecular Formula | C21H17N5 |
| Molecular Weight | 339.40 g/mol |
| Exact Mass | 339.15 |
| IUPAC Name | 2-(1H-imidazo[4,5-f][1,10]phenanthrolin-2-yl)-N,N-dimethylaniline |
| SMILES | CN(C)c1ccccc1-c1nc2c3cccnc3c3ncccc3c2[nH]1 |
| InChI | InChI=1S/C21H17N5/c1-26(2)16-10-4-3-7-13(16)21-24-19-14-8-5-11-22-17(14)18-15(20(19)25-21)9-6-12-23-18/h3-12H,1-2H3,(H,24,25) |
| InChIKey | MXFFDBFOCXICIZ-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 57.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.40 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|