C27H42N4O3 — CID 175823171
butyl 4-[4-[(4,4-dimethylpiperidin-1-yl)methyl]phenyl]-2-oxo-1,4,9-triazaspiro[5.5]undecane-9-carboxylate (PubChem CID 175823171) has the molecular formula C27H42N4O3 and a molecular weight of 470.66 g/mol. Its IUPAC name is butyl 4-[4-[(4,4-dimethylpiperidin-1-yl)methyl]phenyl]-2-oxo-1,4,9-triazaspiro[5.5]undecane-9-carboxylate.
| Compound Name | butyl 4-[4-[(4,4-dimethylpiperidin-1-yl)methyl]phenyl]-2-oxo-1,4,9-triazaspiro[5.5]undecane-9-carboxylate |
|---|---|
| PubChem CID | 175823171 |
| Molecular Formula | C27H42N4O3 |
| Molecular Weight | 470.66 g/mol |
| Exact Mass | 470.33 |
| IUPAC Name | butyl 4-[4-[(4,4-dimethylpiperidin-1-yl)methyl]phenyl]-2-oxo-1,4,9-triazaspiro[5.5]undecane-9-carboxylate |
| SMILES | CCCCOC(=O)N1CCC2(CC1)CN(c1ccc(CN3CCC(C)(C)CC3)cc1)CC(=O)N2 |
| InChI | InChI=1S/C27H42N4O3/c1-4-5-18-34-25(33)30-16-12-27(13-17-30)21-31(20-24(32)28-27)23-8-6-22(7-9-23)19-29-14-10-26(2,3)11-15-29/h6-9H,4-5,10-21H2,1-3H3,(H,28,32) |
| InChIKey | FXBJOBONQKPJIL-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 65.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.66 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|