About (3,5-dichloropyrazolo[1,5-a]pyrimidin-7-yl)carbamic acid
(3,5-dichloropyrazolo[1,5-a]pyrimidin-7-yl)carbamic acid (PubChem CID 175823311) has the molecular formula C7H4Cl2N4O2
and a molecular weight of 247.04 g/mol. Its IUPAC name is (3,5-dichloropyrazolo[1,5-a]pyrimidin-7-yl)carbamic acid.
Molecular Properties
| Compound Name | (3,5-dichloropyrazolo[1,5-a]pyrimidin-7-yl)carbamic acid |
| PubChem CID | 175823311 |
| Molecular Formula | C7H4Cl2N4O2 |
| Molecular Weight | 247.04 g/mol |
| Exact Mass | 245.97 |
| IUPAC Name | (3,5-dichloropyrazolo[1,5-a]pyrimidin-7-yl)carbamic acid |
| SMILES | O=C(O)Nc1cc(Cl)nc2c(Cl)cnn12 |
| InChI | InChI=1S/C7H4Cl2N4O2/c8-3-2-10-13-5(12-7(14)15)1-4(9)11-6(3)13/h1-2,12H,(H,14,15) |
| InChIKey | PLTHLQXTRLDDPK-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 79.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 247.04 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (3,5-dichloropyrazolo[1,5-a]pyrimidin-7-yl)carbamic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3,5-dichloropyrazolo[1,5-a]pyrimidin-7-yl)carbamic acid?
The IUPAC name of (3,5-dichloropyrazolo[1,5-a]pyrimidin-7-yl)carbamic acid (CID 175823311) is (3,5-dichloropyrazolo[1,5-a]pyrimidin-7-yl)carbamic acid.
What is the SMILES notation for (3,5-dichloropyrazolo[1,5-a]pyrimidin-7-yl)carbamic acid?
The canonical SMILES for (3,5-dichloropyrazolo[1,5-a]pyrimidin-7-yl)carbamic acid is O=C(O)Nc1cc(Cl)nc2c(Cl)cnn12.
What is the InChIKey of (3,5-dichloropyrazolo[1,5-a]pyrimidin-7-yl)carbamic acid?
The InChIKey is PLTHLQXTRLDDPK-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H4Cl2N4O2/c8-3-2-10-13-5(12-7(14)15)1-4(9)11-6(3)13/h1-2,12H,(H,14,15).
What are the key properties of (3,5-dichloropyrazolo[1,5-a]pyrimidin-7-yl)carbamic acid?
(3,5-dichloropyrazolo[1,5-a]pyrimidin-7-yl)carbamic acid has a molecular weight of 247.04 g/mol, XLogP of 2.13, 1 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (3,5-dichloropyrazolo[1,5-a]pyrimidin-7-yl)carbamic acid is sourced from PubChem (CID 175823311), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).