About 2-[2-[1-(4-chlorophenyl)triazol-4-yl]-1,3-dioxan-5-yl]acetamide
2-[2-[1-(4-chlorophenyl)triazol-4-yl]-1,3-dioxan-5-yl]acetamide (PubChem CID 175823976) has the molecular formula C14H15ClN4O3
and a molecular weight of 322.75 g/mol. Its IUPAC name is 2-[2-[1-(4-chlorophenyl)triazol-4-yl]-1,3-dioxan-5-yl]acetamide.
Molecular Properties
| Compound Name | 2-[2-[1-(4-chlorophenyl)triazol-4-yl]-1,3-dioxan-5-yl]acetamide |
| PubChem CID | 175823976 |
| Molecular Formula | C14H15ClN4O3 |
| Molecular Weight | 322.75 g/mol |
| Exact Mass | 322.08 |
| IUPAC Name | 2-[2-[1-(4-chlorophenyl)triazol-4-yl]-1,3-dioxan-5-yl]acetamide |
| SMILES | NC(=O)CC1COC(c2cn(-c3ccc(Cl)cc3)nn2)OC1 |
| InChI | InChI=1S/C14H15ClN4O3/c15-10-1-3-11(4-2-10)19-6-12(17-18-19)14-21-7-9(8-22-14)5-13(16)20/h1-4,6,9,14H,5,7-8H2,(H2,16,20) |
| InChIKey | HVEQSKQGHXVOGY-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 92.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 322.75 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 2-[2-[1-(4-chlorophenyl)triazol-4-yl]-1,3-dioxan-5-yl]acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[2-[1-(4-chlorophenyl)triazol-4-yl]-1,3-dioxan-5-yl]acetamide?
The IUPAC name of 2-[2-[1-(4-chlorophenyl)triazol-4-yl]-1,3-dioxan-5-yl]acetamide (CID 175823976) is 2-[2-[1-(4-chlorophenyl)triazol-4-yl]-1,3-dioxan-5-yl]acetamide.
What is the SMILES notation for 2-[2-[1-(4-chlorophenyl)triazol-4-yl]-1,3-dioxan-5-yl]acetamide?
The canonical SMILES for 2-[2-[1-(4-chlorophenyl)triazol-4-yl]-1,3-dioxan-5-yl]acetamide is NC(=O)CC1COC(c2cn(-c3ccc(Cl)cc3)nn2)OC1.
What is the InChIKey of 2-[2-[1-(4-chlorophenyl)triazol-4-yl]-1,3-dioxan-5-yl]acetamide?
The InChIKey is HVEQSKQGHXVOGY-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H15ClN4O3/c15-10-1-3-11(4-2-10)19-6-12(17-18-19)14-21-7-9(8-22-14)5-13(16)20/h1-4,6,9,14H,5,7-8H2,(H2,16,20).
What are the key properties of 2-[2-[1-(4-chlorophenyl)triazol-4-yl]-1,3-dioxan-5-yl]acetamide?
2-[2-[1-(4-chlorophenyl)triazol-4-yl]-1,3-dioxan-5-yl]acetamide has a molecular weight of 322.75 g/mol, XLogP of 1.46, 4 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2-[1-(4-chlorophenyl)triazol-4-yl]-1,3-dioxan-5-yl]acetamide is sourced from PubChem (CID 175823976), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).