About 5-(3,3-difluoropyrrolidin-1-yl)-2-formamidohexanamide
5-(3,3-difluoropyrrolidin-1-yl)-2-formamidohexanamide (PubChem CID 175824324) has the molecular formula C11H19F2N3O2
and a molecular weight of 263.29 g/mol. Its IUPAC name is 5-(3,3-difluoropyrrolidin-1-yl)-2-formamidohexanamide.
Molecular Properties
| Compound Name | 5-(3,3-difluoropyrrolidin-1-yl)-2-formamidohexanamide |
| PubChem CID | 175824324 |
| Molecular Formula | C11H19F2N3O2 |
| Molecular Weight | 263.29 g/mol |
| Exact Mass | 263.14 |
| IUPAC Name | 5-(3,3-difluoropyrrolidin-1-yl)-2-formamidohexanamide |
| SMILES | CC(CCC(NC=O)C(N)=O)N1CCC(F)(F)C1 |
| InChI | InChI=1S/C11H19F2N3O2/c1-8(16-5-4-11(12,13)6-16)2-3-9(10(14)18)15-7-17/h7-9H,2-6H2,1H3,(H2,14,18)(H,15,17) |
| InChIKey | GOASMGKWLNIIFL-UHFFFAOYSA-N |
| XLogP | 0.10 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 263.29 |
| LogP ≤ 5 | 0.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 5-(3,3-difluoropyrrolidin-1-yl)-2-formamidohexanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(3,3-difluoropyrrolidin-1-yl)-2-formamidohexanamide?
The IUPAC name of 5-(3,3-difluoropyrrolidin-1-yl)-2-formamidohexanamide (CID 175824324) is 5-(3,3-difluoropyrrolidin-1-yl)-2-formamidohexanamide.
What is the SMILES notation for 5-(3,3-difluoropyrrolidin-1-yl)-2-formamidohexanamide?
The canonical SMILES for 5-(3,3-difluoropyrrolidin-1-yl)-2-formamidohexanamide is CC(CCC(NC=O)C(N)=O)N1CCC(F)(F)C1.
What is the InChIKey of 5-(3,3-difluoropyrrolidin-1-yl)-2-formamidohexanamide?
The InChIKey is GOASMGKWLNIIFL-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H19F2N3O2/c1-8(16-5-4-11(12,13)6-16)2-3-9(10(14)18)15-7-17/h7-9H,2-6H2,1H3,(H2,14,18)(H,15,17).
What are the key properties of 5-(3,3-difluoropyrrolidin-1-yl)-2-formamidohexanamide?
5-(3,3-difluoropyrrolidin-1-yl)-2-formamidohexanamide has a molecular weight of 263.29 g/mol, XLogP of 0.10, 7 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(3,3-difluoropyrrolidin-1-yl)-2-formamidohexanamide is sourced from PubChem (CID 175824324), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).