About 1-(3-aminopropylamino)-10-methylthiochromeno[2,3-c]quinolin-12-one
1-(3-aminopropylamino)-10-methylthiochromeno[2,3-c]quinolin-12-one (PubChem CID 175824598) has the molecular formula C20H19N3OS
and a molecular weight of 349.46 g/mol. Its IUPAC name is 1-(3-aminopropylamino)-10-methylthiochromeno[2,3-c]quinolin-12-one.
Molecular Properties
| Compound Name | 1-(3-aminopropylamino)-10-methylthiochromeno[2,3-c]quinolin-12-one |
| PubChem CID | 175824598 |
| Molecular Formula | C20H19N3OS |
| Molecular Weight | 349.46 g/mol |
| Exact Mass | 349.12 |
| IUPAC Name | 1-(3-aminopropylamino)-10-methylthiochromeno[2,3-c]quinolin-12-one |
| SMILES | Cc1ccc2sc3cnc4cccc(NCCCN)c4c3c(=O)c2c1 |
| InChI | InChI=1S/C20H19N3OS/c1-12-6-7-16-13(10-12)20(24)19-17(25-16)11-23-15-5-2-4-14(18(15)19)22-9-3-8-21/h2,4-7,10-11,22H,3,8-9,21H2,1H3 |
| InChIKey | CBPMLASYULNGAV-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 349.46 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|
Analyze 1-(3-aminopropylamino)-10-methylthiochromeno[2,3-c]quinolin-12-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(3-aminopropylamino)-10-methylthiochromeno[2,3-c]quinolin-12-one?
The IUPAC name of 1-(3-aminopropylamino)-10-methylthiochromeno[2,3-c]quinolin-12-one (CID 175824598) is 1-(3-aminopropylamino)-10-methylthiochromeno[2,3-c]quinolin-12-one.
What is the SMILES notation for 1-(3-aminopropylamino)-10-methylthiochromeno[2,3-c]quinolin-12-one?
The canonical SMILES for 1-(3-aminopropylamino)-10-methylthiochromeno[2,3-c]quinolin-12-one is Cc1ccc2sc3cnc4cccc(NCCCN)c4c3c(=O)c2c1.
What is the InChIKey of 1-(3-aminopropylamino)-10-methylthiochromeno[2,3-c]quinolin-12-one?
The InChIKey is CBPMLASYULNGAV-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H19N3OS/c1-12-6-7-16-13(10-12)20(24)19-17(25-16)11-23-15-5-2-4-14(18(15)19)22-9-3-8-21/h2,4-7,10-11,22H,3,8-9,21H2,1H3.
What are the key properties of 1-(3-aminopropylamino)-10-methylthiochromeno[2,3-c]quinolin-12-one?
1-(3-aminopropylamino)-10-methylthiochromeno[2,3-c]quinolin-12-one has a molecular weight of 349.46 g/mol, XLogP of 4.03, 4 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(3-aminopropylamino)-10-methylthiochromeno[2,3-c]quinolin-12-one is sourced from PubChem (CID 175824598), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).