About tert-butyl-(5,6-dihydro-4H-pyrrolo[3,4-c]pyrazol-2-ylmethoxy)-dimethylsilane
tert-butyl-(5,6-dihydro-4H-pyrrolo[3,4-c]pyrazol-2-ylmethoxy)-dimethylsilane (PubChem CID 175824634) has the molecular formula C12H23N3OSi
and a molecular weight of 253.42 g/mol. Its IUPAC name is tert-butyl-(5,6-dihydro-4H-pyrrolo[3,4-c]pyrazol-2-ylmethoxy)-dimethylsilane.
Molecular Properties
| Compound Name | tert-butyl-(5,6-dihydro-4H-pyrrolo[3,4-c]pyrazol-2-ylmethoxy)-dimethylsilane |
| PubChem CID | 175824634 |
| Molecular Formula | C12H23N3OSi |
| Molecular Weight | 253.42 g/mol |
| Exact Mass | 253.16 |
| IUPAC Name | tert-butyl-(5,6-dihydro-4H-pyrrolo[3,4-c]pyrazol-2-ylmethoxy)-dimethylsilane |
| SMILES | CC(C)(C)[Si](C)(C)OCn1cc2c(n1)CNC2 |
| InChI | InChI=1S/C12H23N3OSi/c1-12(2,3)17(4,5)16-9-15-8-10-6-13-7-11(10)14-15/h8,13H,6-7,9H2,1-5H3 |
| InChIKey | BWWCRMLMHHMETH-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 39.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 253.42 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze tert-butyl-(5,6-dihydro-4H-pyrrolo[3,4-c]pyrazol-2-ylmethoxy)-dimethylsilane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl-(5,6-dihydro-4H-pyrrolo[3,4-c]pyrazol-2-ylmethoxy)-dimethylsilane?
The IUPAC name of tert-butyl-(5,6-dihydro-4H-pyrrolo[3,4-c]pyrazol-2-ylmethoxy)-dimethylsilane (CID 175824634) is tert-butyl-(5,6-dihydro-4H-pyrrolo[3,4-c]pyrazol-2-ylmethoxy)-dimethylsilane.
What is the SMILES notation for tert-butyl-(5,6-dihydro-4H-pyrrolo[3,4-c]pyrazol-2-ylmethoxy)-dimethylsilane?
The canonical SMILES for tert-butyl-(5,6-dihydro-4H-pyrrolo[3,4-c]pyrazol-2-ylmethoxy)-dimethylsilane is CC(C)(C)[Si](C)(C)OCn1cc2c(n1)CNC2.
What is the InChIKey of tert-butyl-(5,6-dihydro-4H-pyrrolo[3,4-c]pyrazol-2-ylmethoxy)-dimethylsilane?
The InChIKey is BWWCRMLMHHMETH-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H23N3OSi/c1-12(2,3)17(4,5)16-9-15-8-10-6-13-7-11(10)14-15/h8,13H,6-7,9H2,1-5H3.
What are the key properties of tert-butyl-(5,6-dihydro-4H-pyrrolo[3,4-c]pyrazol-2-ylmethoxy)-dimethylsilane?
tert-butyl-(5,6-dihydro-4H-pyrrolo[3,4-c]pyrazol-2-ylmethoxy)-dimethylsilane has a molecular weight of 253.42 g/mol, XLogP of 2.47, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl-(5,6-dihydro-4H-pyrrolo[3,4-c]pyrazol-2-ylmethoxy)-dimethylsilane is sourced from PubChem (CID 175824634), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).