C3HF4I — CID 175825557
1,2,3,3-tetrafluoro-1-iodoprop-1-ene (PubChem CID 175825557) has the molecular formula C3HF4I and a molecular weight of 239.94 g/mol. Its IUPAC name is 1,2,3,3-tetrafluoro-1-iodoprop-1-ene.
| Compound Name | 1,2,3,3-tetrafluoro-1-iodoprop-1-ene |
|---|---|
| PubChem CID | 175825557 |
| Molecular Formula | C3HF4I |
| Molecular Weight | 239.94 g/mol |
| Exact Mass | 239.91 |
| IUPAC Name | 1,2,3,3-tetrafluoro-1-iodoprop-1-ene |
| SMILES | FC(I)=C(F)C(F)F |
| InChI | InChI=1S/C3HF4I/c4-1(2(5)6)3(7)8/h2H |
| InChIKey | WEWPSOVDRLKFCC-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.94 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|